This is the mail archive of the glibc-cvs@sourceware.org mailing list for the glibc project.


Index Nav: [Date Index] [Subject Index] [Author Index] [Thread Index]
Message Nav: [Date Prev] [Date Next] [Thread Prev] [Thread Next]
Other format: [Raw text]

GNU C Library master sources branch siddhesh/benchmarks created. glibc-2.18-886-g1367400


This is an automated email from the git hooks/post-receive script. It was
generated because a ref change was pushed to the repository containing
the project "GNU C Library master sources".

The branch, siddhesh/benchmarks has been created
        at  13674005345deeac71debaa994fe89cecf6cdb2a (commit)

- Log -----------------------------------------------------------------
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=13674005345deeac71debaa994fe89cecf6cdb2a

commit 13674005345deeac71debaa994fe89cecf6cdb2a
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date:   Mon Feb 3 12:36:15 2014 +0530

    Make bench.out in json format

diff --git a/benchtests/Makefile b/benchtests/Makefile
index 7f7145a..0e0704a 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -115,11 +115,13 @@ bench-set: $(binaries-benchset)
 	done
 
 bench-func: $(binaries-bench)
-	{ ./machine-info.sh; \
+	{ echo "{"; \
+	./machine-info.sh; \
 	for run in $^; do \
 	  echo "Running $${run}" >&2; \
 	  $(run-bench) $(DETAILED_OPT); \
-	done; } > $(objpfx)bench.out-tmp; \
+	done; \
+	echo "}"; } > $(objpfx)bench.out-tmp; \
 	if [ -f $(objpfx)bench.out ]; then \
 	  mv -f $(objpfx)bench.out $(objpfx)bench.out.old; \
 	fi; \
diff --git a/benchtests/machine-info.sh b/benchtests/machine-info.sh
index aa09da5..041da30 100755
--- a/benchtests/machine-info.sh
+++ b/benchtests/machine-info.sh
@@ -1,13 +1,12 @@
 #!/bin/sh
 # Simple script to get some basic machine information
 
-{ sed -n -e 's/\(vendor_id\)[ \t]\+:/1. \1:/p' \
-	 -e 's/\(cpu family\)[ \t]\+:/2. \1:/p' \
-	 -e 's/\(model\)[ \t]\+:/3. \1:/p' \
-	 -e 's/\(cpu cores\)[ \t]\+:/4. \1:/p' \
-	 -e 's/\(cache size\)[ \t]\+:/6. \1:/p' \
-	 -e 's/MemTotal:[ \t]\+\(.*\)/7. memory: \1/p' \
-	 -e 's/SwapTotal:[ \t]\+\(.*\)/8. swap: \1/p' \
-	 /proc/cpuinfo /proc/meminfo; \
-	echo 5. processors: $(grep -c 'processor' /proc/cpuinfo); } | 
-	sort -u
+sed -n  -e 's/vendor_id[ \t]\+:\(.*\)/  "vendor-id": \1,/p' \
+	-e 's/cpu family[ \t]\+:\(.*\)/  "cpu-family": \1,/p' \
+	-e 's/\(model\)[ \t]\+:\(.*\)/  "\1": \1,/p' \
+	-e 's/cpu cores[ \t]\+:\(.*\)/  "cpu-cores": \1,/p' \
+	-e 's/cache size[ \t]\+:\([0-9]\+\).*/  "cache-size": \1,/p' \
+	-e 's/MemTotal:[ \t]\+\([0-9]\+\).*/  "memory": \1,/p' \
+	-e 's/SwapTotal:[ \t]\+\([0-9]\+\).*/  "swap": \1,/p' \
+	 /proc/cpuinfo /proc/meminfo | sort -u
+echo "  \"processors\": $(grep -c 'processor' /proc/cpuinfo),"

http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=1d68d06ad65bca949ddeeacfce1d5be34c05c30b

commit 1d68d06ad65bca949ddeeacfce1d5be34c05c30b
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date:   Fri Jan 17 18:14:57 2014 +0530

    Add machine info

diff --git a/benchtests/Makefile b/benchtests/Makefile
index 9e6c58e..7f7145a 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -115,7 +115,8 @@ bench-set: $(binaries-benchset)
 	done
 
 bench-func: $(binaries-bench)
-	{ for run in $^; do \
+	{ ./machine-info.sh; \
+	for run in $^; do \
 	  echo "Running $${run}" >&2; \
 	  $(run-bench) $(DETAILED_OPT); \
 	done; } > $(objpfx)bench.out-tmp; \
diff --git a/benchtests/machine-info.sh b/benchtests/machine-info.sh
new file mode 100755
index 0000000..aa09da5
--- /dev/null
+++ b/benchtests/machine-info.sh
@@ -0,0 +1,13 @@
+#!/bin/sh
+# Simple script to get some basic machine information
+
+{ sed -n -e 's/\(vendor_id\)[ \t]\+:/1. \1:/p' \
+	 -e 's/\(cpu family\)[ \t]\+:/2. \1:/p' \
+	 -e 's/\(model\)[ \t]\+:/3. \1:/p' \
+	 -e 's/\(cpu cores\)[ \t]\+:/4. \1:/p' \
+	 -e 's/\(cache size\)[ \t]\+:/6. \1:/p' \
+	 -e 's/MemTotal:[ \t]\+\(.*\)/7. memory: \1/p' \
+	 -e 's/SwapTotal:[ \t]\+\(.*\)/8. swap: \1/p' \
+	 /proc/cpuinfo /proc/meminfo; \
+	echo 5. processors: $(grep -c 'processor' /proc/cpuinfo); } | 
+	sort -u

http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=b7b08b0cafeef894193e8201e4307d776851c6d1

commit b7b08b0cafeef894193e8201e4307d776851c6d1
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date:   Thu Jan 16 15:09:10 2014 +0530

    Remove bench-modf.c

diff --git a/benchtests/bench-modf.c b/benchtests/bench-modf.c
deleted file mode 100644
index 407360c..0000000
--- a/benchtests/bench-modf.c
+++ /dev/null
@@ -1,44 +0,0 @@
-/* Copyright (C) 2013-2014 Free Software Foundation, Inc.
-   This file is part of the GNU C Library.
-
-   The GNU C Library is free software; you can redistribute it and/or
-   modify it under the terms of the GNU Lesser General Public
-   License as published by the Free Software Foundation; either
-   version 2.1 of the License, or (at your option) any later version.
-
-   The GNU C Library is distributed in the hope that it will be useful,
-   but WITHOUT ANY WARRANTY; without even the implied warranty of
-   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
-   Lesser General Public License for more details.
-
-   You should have received a copy of the GNU Lesser General Public
-   License along with the GNU C Library; if not, see
-   <http://www.gnu.org/licenses/>.  */
-
-extern double modf (double, double *);
-
-#define CALL_BENCH_FUNC(j, i) modf (in[j].arg0, &i);
-
-struct args
-{
-  volatile double arg0;
-} in[] =
-{
-  {  42.42 },
-  { -42.42 }
-};
-
-#define NUM_VARIANTS 1
-#define NUM_SAMPLES(v) (sizeof (in) / sizeof (struct args))
-
-static volatile double ret = 0.0;
-#define BENCH_FUNC(v, j) \
-({									      \
-  double iptr;								      \
-  ret =  CALL_BENCH_FUNC (j, iptr);					      \
-})
-
-#define FUNCNAME "modf"
-#define VARIANT(v) FUNCNAME "()"
-
-#include "bench-skeleton.c"
diff --git a/benchtests/modf-inputs b/benchtests/modf-inputs
new file mode 100644
index 0000000..4fcc99b
--- /dev/null
+++ b/benchtests/modf-inputs
@@ -0,0 +1,4 @@
+## includes: math.h
+## args: double:<double *>
+42.0
+-42.0

http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=12387852c7e6d76c7f109366f5e94040d0330175

commit 12387852c7e6d76c7f109366f5e94040d0330175
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date:   Wed Jan 15 12:48:09 2014 +0530

    Detailed benchmark numbers
    
    Store timings per input.

diff --git a/benchtests/Makefile b/benchtests/Makefile
index 792f61f..9e6c58e 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -84,6 +84,12 @@ ifdef USE_CLOCK_GETTIME
 CPPFLAGS-nonlib += -DUSE_CLOCK_GETTIME
 endif
 
+DETAILED_OPT :=
+
+ifdef DETAILED
+DETAILED_OPT := -d
+endif
+
 # This makes sure CPPFLAGS-nonlib and CFLAGS-nonlib are passed
 # for all these modules.
 cpp-srcs-left := $(binaries-benchset:=.c) $(binaries-bench:=.c)
@@ -111,7 +117,7 @@ bench-set: $(binaries-benchset)
 bench-func: $(binaries-bench)
 	{ for run in $^; do \
 	  echo "Running $${run}" >&2; \
-	  $(run-bench); \
+	  $(run-bench) $(DETAILED_OPT); \
 	done; } > $(objpfx)bench.out-tmp; \
 	if [ -f $(objpfx)bench.out ]; then \
 	  mv -f $(objpfx)bench.out $(objpfx)bench.out.old; \
diff --git a/benchtests/bench-skeleton.c b/benchtests/bench-skeleton.c
index 4290e76..1a124a2 100644
--- a/benchtests/bench-skeleton.c
+++ b/benchtests/bench-skeleton.c
@@ -18,6 +18,7 @@
 
 #include <string.h>
 #include <stdint.h>
+#include <stdbool.h>
 #include <stdio.h>
 #include <time.h>
 #include <inttypes.h>
@@ -48,6 +49,10 @@ main (int argc, char **argv)
   unsigned long i, k;
   struct timespec runtime;
   timing_t start, end;
+  bool detailed = false;
+
+  if (argc == 2 && !strcmp (argv[1], "-d"))
+    detailed = true;
 
   startup();
 
@@ -59,6 +64,9 @@ main (int argc, char **argv)
 
   iters = 1000 * res;
 
+  if (detailed)
+    printf ("%s\n", FUNCNAME);
+
   for (int v = 0; v < NUM_VARIANTS; v++)
     {
       /* Run for approximately DURATION seconds.  */
@@ -67,6 +75,7 @@ main (int argc, char **argv)
 
       double d_total_i = 0;
       timing_t total = 0, max = 0, min = 0x7fffffffffffffff;
+      int64_t c = 0;
       while (1)
 	{
 	  for (i = 0; i < NUM_SAMPLES (v); i++)
@@ -86,9 +95,13 @@ main (int argc, char **argv)
 		min = cur;
 
 	      TIMING_ACCUM (total, cur);
+	      /* Accumulate timings for the value.  In the end we will divide
+	         by the total iterations.  */
+	      RESULT_ACCUM (cur, v, i, c * iters, (c + 1) * iters);
 
 	      d_total_i += iters;
 	    }
+	  c++;
 	  struct timespec curtime;
 
 	  memset (&curtime, 0, sizeof (curtime));
@@ -104,8 +117,17 @@ main (int argc, char **argv)
       d_total_s = total;
       d_iters = iters;
 
-      TIMING_PRINT_STATS (VARIANT (v), d_total_s, d_iters, d_total_i, max,
-			  min);
+      if (!detailed)
+	{
+	  TIMING_PRINT_STATS (VARIANT (v), d_total_s, d_iters, d_total_i, max,
+			      min);
+	}
+      else
+	{
+	  printf ("\t%s\n", VARIANT (v));
+	  for (int i = 0; i < NUM_SAMPLES (v); i++)
+	    printf ("\t\t%g\n", RESULT (v, i));
+	}
     }
 
   return 0;
diff --git a/scripts/bench.py b/scripts/bench.py
index 81ffc15..11f616f 100755
--- a/scripts/bench.py
+++ b/scripts/bench.py
@@ -50,6 +50,7 @@ STRUCT_TEMPLATE = '''
 struct args
 {
 %(args)s
+  double timing;
 };
 
 struct _variants
@@ -80,6 +81,9 @@ struct _variants variants[%(num_variants)d] = {
 
 # Epilogue for the generated source file.
 EPILOGUE = '''
+#define RESULT(__v, __i) (variants[(__v)].in[(__i)].timing)
+#define RESULT_ACCUM(r, v, i, old, new) \\
+        ((RESULT ((v), (i))) = (RESULT ((v), (i)) * (old) + (r)) / ((new) + 1))
 #define BENCH_FUNC(i, j) ({%(getret)s CALL_BENCH_FUNC (i, j);})
 #define FUNCNAME "%(func)s"
 #include "bench-skeleton.c"'''
@@ -168,7 +172,7 @@ def _print_arg_data(func, directives, all_vals):
     # Now print the values.
     variants = []
     for (k, vals), i in zip(all_vals.items(), itertools.count()):
-        out = ['  {%s},' % v for v in vals]
+        out = ['  {%s, 0},' % v for v in vals]
 
         # Members for the variants structure list that we will
         # print later.

http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=5f2f18db8382f26580b23004e6f2f87b9b80318b

commit 5f2f18db8382f26580b23004e6f2f87b9b80318b
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date:   Fri Dec 6 13:51:09 2013 +0530

    Implement benchmarking script in python

diff --git a/benchtests/Makefile b/benchtests/Makefile
index 8bfb039..792f61f 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -127,5 +127,5 @@ $(objpfx)bench-%.c: %-inputs $(bench-deps)
 	{ if [ -n "$($*-INCLUDE)" ]; then \
 	  cat $($*-INCLUDE); \
 	fi; \
-	$(..)scripts/bench.pl $(patsubst %-inputs,%,$<); } > $@-tmp
+	$(..)scripts/bench.py $(patsubst %-inputs,%,$<); } > $@-tmp
 	mv -f $@-tmp $@
diff --git a/benchtests/README b/benchtests/README
index a5fd8da..2a940fa 100644
--- a/benchtests/README
+++ b/benchtests/README
@@ -8,7 +8,9 @@ basic performance properties of the function.
 Running the benchmark:
 =====================
 
-The benchmark can be executed by invoking make as follows:
+The benchmark needs python 2.7 or later in addition to the
+dependencies required to build the GNU C Library.  One may run the
+benchmark by invoking make as follows:
 
   $ make bench
 
diff --git a/scripts/bench.pl b/scripts/bench.pl
deleted file mode 100755
index 569cd51..0000000
--- a/scripts/bench.pl
+++ /dev/null
@@ -1,205 +0,0 @@
-#! /usr/bin/perl -w
-# Copyright (C) 2013-2014 Free Software Foundation, Inc.
-# This file is part of the GNU C Library.
-
-# The GNU C Library is free software; you can redistribute it and/or
-# modify it under the terms of the GNU Lesser General Public
-# License as published by the Free Software Foundation; either
-# version 2.1 of the License, or (at your option) any later version.
-
-# The GNU C Library is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
-# Lesser General Public License for more details.
-
-# You should have received a copy of the GNU Lesser General Public
-# License along with the GNU C Library; if not, see
-# <http://www.gnu.org/licenses/>.
-
-
-use strict;
-use warnings;
-# Generate a benchmark source file for a given input.
-
-if (@ARGV < 1) {
-  die "Usage: bench.pl <function>"
-}
-
-my $func = $ARGV[0];
-my @args;
-my $ret = "void";
-my $getret = "";
-
-# We create a hash of inputs for each variant of the test.
-my $variant = "";
-my @curvals;
-my %vals;
-my @include_headers;
-my @include_sources;
-my $incl;
-
-open INPUTS, "<$func-inputs" or die $!;
-
-LINE:while (<INPUTS>) {
-  chomp;
-
-  # Directives.
-  if (/^## ([\w-]+): (.*)/) {
-    # Function argument types.
-    if ($1 eq "args") {
-      @args = split(":", $2);
-    }
-
-    # Function return type.
-    elsif ($1 eq "ret") {
-      $ret = $2;
-    }
-
-    elsif ($1 eq "includes") {
-      @include_headers = split (",", $2);
-    }
-
-    elsif ($1 eq "include-sources") {
-      @include_sources = split (",", $2);
-    }
-
-    # New variant.  This is the only directive allowed in the body of the
-    # inputs to separate inputs into variants.  All others should be at the
-    # top or else all hell will break loose.
-    elsif ($1 eq "name") {
-
-      # Save values in the previous variant.
-      my @copy = @curvals;
-      $vals{$variant} = \@copy;
-
-      # Prepare for the next.
-      $variant=$2;
-      undef @curvals;
-      next LINE;
-    }
-
-    else {
-      die "Unknown directive: ".$1;
-    }
-  }
-
-  # Skip over comments and blank lines.
-  if (/^#/ || /^$/) {
-    next LINE;
-  }
-  push (@curvals, $_);
-}
-
-
-my $bench_func = "#define CALL_BENCH_FUNC(v, i) $func (";
-
-# Output variables.  These include the return value as well as any pointers
-# that may get passed into the function, denoted by the <> around the type.
-my $outvars = "";
-
-if ($ret ne "void") {
-  $outvars = "static $ret volatile ret;\n";
-}
-
-# Print the definitions and macros.
-foreach $incl (@include_headers) {
-  print "#include <" . $incl . ">\n";
-}
-
-# Print the source files.
-foreach $incl (@include_sources) {
-  print "#include \"" . $incl . "\"\n";
-}
-
-if (@args > 0) {
-  # Save values in the last variant.
-  $vals{$variant} = \@curvals;
-  my $struct =
-    "struct _variants
-    {
-      const char *name;
-      int count;
-      struct args *in;
-    };\n";
-
-  my $arg_struct = "struct args {";
-
-  my $num = 0;
-  my $arg;
-  foreach $arg (@args) {
-    if ($num > 0) {
-      $bench_func = "$bench_func,";
-    }
-
-    $_ = $arg;
-    if (/<(.*)\*>/) {
-      # Output variables.  These have to be pointers, so dereference once by
-      # dropping one *.
-      $outvars = $outvars . "static $1 out$num;\n";
-      $bench_func = "$bench_func &out$num";
-    }
-    else {
-      $arg_struct = "$arg_struct $arg volatile arg$num;";
-      $bench_func = "$bench_func variants[v].in[i].arg$num";
-    }
-
-    $num = $num + 1;
-  }
-
-  $arg_struct = $arg_struct . "};\n";
-  $bench_func = $bench_func . ");\n";
-
-  print $bench_func;
-  print $arg_struct;
-  print $struct;
-
-  my $c = 0;
-  my $key;
-
-  # Print the input arrays.
-  foreach $key (keys %vals) {
-    my @arr = @{$vals{$key}};
-
-    print "struct args in" . $c . "[" . @arr . "] = {\n";
-    foreach (@arr) {
-      print "{$_},\n";
-    }
-    print "};\n\n";
-    $c += 1;
-  }
-
-  # The variants.  Each variant then points to the appropriate input array we
-  # defined above.
-  print "struct _variants variants[" . (keys %vals) . "] = {\n";
-  $c = 0;
-  foreach $key (keys %vals) {
-    print "{\"$func($key)\", " . @{$vals{$key}} . ", in$c},\n";
-    $c += 1;
-  }
-  print "};\n\n";
-  # Finally, print the last set of macros.
-  print "#define NUM_VARIANTS $c\n";
-  print "#define NUM_SAMPLES(i) (variants[i].count)\n";
-  print "#define VARIANT(i) (variants[i].name)\n";
-}
-else {
-  print $bench_func . ");\n";
-  print "#define NUM_VARIANTS (1)\n";
-  print "#define NUM_SAMPLES(v) (1)\n";
-  print "#define VARIANT(v) FUNCNAME \"()\"\n"
-}
-
-# Print the output variable definitions.
-print "$outvars\n";
-
-# In some cases not storing a return value seems to result in the function call
-# being optimized out.
-if ($ret ne "void") {
-  $getret = "ret = ";
-}
-
-# And we're done.
-print "#define BENCH_FUNC(i, j) ({$getret CALL_BENCH_FUNC (i, j);})\n";
-
-print "#define FUNCNAME \"$func\"\n";
-print "#include \"bench-skeleton.c\"\n";
diff --git a/scripts/bench.py b/scripts/bench.py
new file mode 100755
index 0000000..81ffc15
--- /dev/null
+++ b/scripts/bench.py
@@ -0,0 +1,299 @@
+#!/usr/bin/python
+# Copyright (C) 2014 Free Software Foundation, Inc.
+# This file is part of the GNU C Library.
+#
+# The GNU C Library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# The GNU C Library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with the GNU C Library; if not, see
+# <http://www.gnu.org/licenses/>.
+
+"""Benchmark program generator script
+
+This script takes a function name as input and generates a program using
+an input file located in the benchtests directory.  The name of the
+input file should be of the form foo-inputs where 'foo' is the name of
+the function.
+"""
+
+from __future__ import print_function
+import sys
+import os
+import itertools
+
+# Macro definitions for functions that take no arguments.  For functions
+# that take arguments, the STRUCT_TEMPLATE, ARGS_TEMPLATE and
+# VARIANTS_TEMPLATE are used instead.
+DEFINES_TEMPLATE = '''
+#define CALL_BENCH_FUNC(v, i) %(func)s ()
+#define NUM_VARIANTS (1)
+#define NUM_SAMPLES(v) (1)
+#define VARIANT(v) FUNCNAME "()"
+'''
+
+# Structures to store arguments for the function call.  A function may
+# have its inputs partitioned to represent distinct performance
+# characteristics or distinct flavors of the function.  Each such
+# variant is represented by the _VARIANT structure.  The ARGS structure
+# represents a single set of arguments.
+STRUCT_TEMPLATE = '''
+#define CALL_BENCH_FUNC(v, i) %(func)s (%(func_args)s)
+
+struct args
+{
+%(args)s
+};
+
+struct _variants
+{
+  const char *name;
+  int count;
+  struct args *in;
+};
+'''
+
+# The actual input arguments.
+ARGS_TEMPLATE = '''
+struct args in%(argnum)d[%(num_args)d] = {
+%(args)s
+};
+'''
+
+# The actual variants, along with macros defined to access the variants.
+VARIANTS_TEMPLATE = '''
+struct _variants variants[%(num_variants)d] = {
+%(variants)s
+};
+
+#define NUM_VARIANTS %(num_variants)d
+#define NUM_SAMPLES(i) (variants[i].count)
+#define VARIANT(i) (variants[i].name)
+'''
+
+# Epilogue for the generated source file.
+EPILOGUE = '''
+#define BENCH_FUNC(i, j) ({%(getret)s CALL_BENCH_FUNC (i, j);})
+#define FUNCNAME "%(func)s"
+#include "bench-skeleton.c"'''
+
+
+def gen_source(func, directives, all_vals):
+    """Generate source for the function
+
+    Generate the C source for the function from the values and
+    directives.
+
+    Args:
+      func: The function name
+      directives: A dictionary of directives applicable to this function
+      all_vals: A dictionary input values
+    """
+    # The includes go in first.
+    for header in directives['includes']:
+        print('#include <%s>' % header)
+
+    for header in directives['include-sources']:
+        print('#include "%s"' % header)
+
+    # Print macros.  This branches out to a separate routine if
+    # the function takes arguments.
+    if not directives['args']:
+        print(DEFINES_TEMPLATE % {'func': func})
+        outargs = []
+    else:
+        outargs = _print_arg_data(func, directives, all_vals)
+
+    # Print the output variable definitions if necessary.
+    for out in outargs:
+        print(out)
+
+    # If we have a return value from the function, make sure it is
+    # assigned to prevent the compiler from optimizing out the
+    # call.
+    if directives['ret']:
+        print('static %s volatile ret;' % directives['ret'])
+        getret = 'ret = '
+    else:
+        getret = ''
+
+    print(EPILOGUE % {'getret': getret, 'func': func})
+
+
+def _print_arg_data(func, directives, all_vals):
+    """Print argument data
+
+    This is a helper function for gen_source that prints structure and
+    values for arguments and their variants and returns output arguments
+    if any are found.
+
+    Args:
+      func: Function name
+      directives: A dictionary of directives applicable to this function
+      all_vals: A dictionary input values
+
+    Returns:
+      Returns a list of definitions for function arguments that act as
+      output parameters.
+    """
+    # First, all of the definitions.  We process writing of
+    # CALL_BENCH_FUNC, struct args and also the output arguments
+    # together in a single traversal of the arguments list.
+    func_args = []
+    arg_struct = []
+    outargs = []
+
+    for arg, i in zip(directives['args'], itertools.count()):
+        if arg[0] == '<' and arg[-1] == '>':
+            pos = arg.rfind('*')
+            if pos == -1:
+                die('Output argument must be a pointer type')
+
+            outargs.append('static %s out%d;' % (arg[1:pos], i))
+            func_args.append(' &out%d' % i)
+        else:
+            arg_struct.append('  %s volatile arg%d;' % (arg, i))
+            func_args.append('variants[v].in[i].arg%d' % i)
+
+    print(STRUCT_TEMPLATE % {'args' : '\n'.join(arg_struct), 'func': func,
+                             'func_args': ', '.join(func_args)})
+
+    # Now print the values.
+    variants = []
+    for (k, vals), i in zip(all_vals.items(), itertools.count()):
+        out = ['  {%s},' % v for v in vals]
+
+        # Members for the variants structure list that we will
+        # print later.
+        variants.append('  {"%s(%s)", %d, in%d},' % (func, k, len(vals), i))
+        print(ARGS_TEMPLATE % {'argnum': i, 'num_args': len(vals),
+                               'args': '\n'.join(out)})
+
+    # Print the variants and the last set of macros.
+    print(VARIANTS_TEMPLATE % {'num_variants': len(all_vals),
+                               'variants': '\n'.join(variants)})
+    return outargs
+
+
+def _process_directive(d_name, d_val):
+    """Process a directive.
+
+    Evaluate the directive name and value passed and return the
+    processed value. This is a helper function for parse_file.
+
+    Args:
+      d_name: Name of the directive
+      d_value: The string value to process
+
+    Returns:
+      The processed value, which may be the string as it is or an object
+      that describes the directive.
+    """
+    # Process the directive values if necessary.  name and ret don't
+    # need any processing.
+    if d_name.startswith('include'):
+        d_val = d_val.split(',')
+    elif d_name == 'args':
+        d_val = d_val.split(':')
+
+    # Return the values.
+    return d_val
+
+
+def parse_file(func):
+    """Parse an input file
+
+    Given a function name, open and parse an input file for the function
+    and get the necessary parameters for the generated code and the list
+    of inputs.
+
+    Args:
+      func: The function name
+
+    Returns:
+      A tuple of two elements, one a dictionary of directives and the
+      other a dictionary of all input values.
+    """
+    all_vals = {}
+    # Valid directives.
+    directives = {
+            'name': '',
+            'args': [],
+            'includes': [],
+            'include-sources': [],
+            'ret': ''
+    }
+
+    try:
+        with open('%s-inputs' % func) as f:
+            for line in f:
+                # Look for directives and parse it if found.
+                if line.startswith('##'):
+                    try:
+                        d_name, d_val = line[2:].split(':', 1)
+                        d_name = d_name.strip()
+                        d_val = d_val.strip()
+                        directives[d_name] = _process_directive(d_name, d_val)
+                    except (IndexError, KeyError):
+                        die('Invalid directive: %s' % line[2:])
+
+                # Skip blank lines and comments.
+                line = line.split('#', 1)[0].rstrip()
+                if not line:
+                    continue
+
+                # Otherwise, we're an input.  Add to the appropriate
+                # input set.
+                cur_name = directives['name']
+                all_vals.setdefault(cur_name, [])
+                all_vals[cur_name].append(line)
+    except IOError as ex:
+        die("Failed to open input file (%s): %s" % (ex.filename, ex.strerror))
+
+    return directives, all_vals
+
+
+def die(msg):
+    """Exit with an error
+
+    Prints an error message to the standard error stream and exits with
+    a non-zero status.
+
+    Args:
+      msg: The error message to print to standard error.
+    """
+    print('%s\n' % msg, file=sys.stderr)
+    sys.exit(os.EX_DATAERR)
+
+
+def main(args):
+    """Main function
+
+    Use the first command line argument as function name and parse its
+    input file to generate C source that calls the function repeatedly
+    for the input.
+
+    Args:
+      args: The command line arguments with the program name dropped.
+
+    Returns:
+      os.EX_USAGE on error and os.EX_OK on success.
+    """
+    if len(args) != 1:
+        print('Usage: %s <function>' % sys.argv[0])
+        return os.EX_USAGE
+
+    directives, all_vals = parse_file(args[0])
+    gen_source(args[0], directives, all_vals)
+    return os.EX_OK
+
+
+if __name__ == '__main__':
+    sys.exit(main(sys.argv[1:]))
diff --git a/scripts/pylint b/scripts/pylint
new file mode 100755
index 0000000..49a775e
--- /dev/null
+++ b/scripts/pylint
@@ -0,0 +1,5 @@
+#!/bin/sh
+# Simple wrapper around the pylint program that uses the pylintrc file to
+# validate the source code in files passed on command line.
+
+exec pylint --rcfile "${0%/*}/pylintrc" "$@"
diff --git a/scripts/pylintrc b/scripts/pylintrc
new file mode 100644
index 0000000..a05ddfd
--- /dev/null
+++ b/scripts/pylintrc
@@ -0,0 +1,274 @@
+[MASTER]
+
+# Specify a configuration file.
+#rcfile=
+
+# Python code to execute, usually for sys.path manipulation such as
+# pygtk.require().
+#init-hook=
+
+# Profiled execution.
+profile=no
+
+# Add files or directories to the blacklist. They should be base names, not
+# paths.
+ignore=CVS
+
+# Pickle collected data for later comparisons.
+persistent=yes
+
+# List of plugins (as comma separated values of python modules names) to load,
+# usually to register additional checkers.
+load-plugins=
+
+
+[MESSAGES CONTROL]
+
+# Enable the message, report, category or checker with the given id(s). You can
+# either give multiple identifier separated by comma (,) or put this option
+# multiple time. See also the "--disable" option for examples.
+#enable=
+
+# Disable the message, report, category or checker with the given id(s). You
+# can either give multiple identifiers separated by comma (,) or put this
+# option multiple times (only on the command line, not in the configuration
+# file where it should appear only once).You can also use "--disable=all" to
+# disable everything first and then reenable specific checks. For example, if
+# you want to run only the similarities checker, you can use "--disable=all
+# --enable=similarities". If you want to run only the classes checker, but have
+# no Warning level messages displayed, use"--disable=all --enable=classes
+# --disable=W"
+#disable=
+
+
+[REPORTS]
+
+# Set the output format. Available formats are text, parseable, colorized, msvs
+# (visual studio) and html. You can also give a reporter class, eg
+# mypackage.mymodule.MyReporterClass.
+output-format=text
+
+# Put messages in a separate file for each module / package specified on the
+# command line instead of printing them on stdout. Reports (if any) will be
+# written in a file name "pylint_global.[txt|html]".
+files-output=no
+
+# Tells whether to display a full report or only the messages
+reports=yes
+
+# Python expression which should return a note less than 10 (10 is the highest
+# note). You have access to the variables errors warning, statement which
+# respectively contain the number of errors / warnings messages and the total
+# number of statements analyzed. This is used by the global evaluation report
+# (RP0004).
+evaluation=10.0 - ((float(5 * error + warning + refactor + convention) / statement) * 10)
+
+# Add a comment according to your evaluation note. This is used by the global
+# evaluation report (RP0004).
+comment=no
+
+# Template used to display messages. This is a python new-style format string
+# used to format the massage information. See doc for all details
+#msg-template=
+
+
+[MISCELLANEOUS]
+
+# List of note tags to take in consideration, separated by a comma.
+notes=FIXME,XXX,TODO
+
+
+[SIMILARITIES]
+
+# Minimum lines number of a similarity.
+min-similarity-lines=4
+
+# Ignore comments when computing similarities.
+ignore-comments=yes
+
+# Ignore docstrings when computing similarities.
+ignore-docstrings=yes
+
+# Ignore imports when computing similarities.
+ignore-imports=no
+
+
+[BASIC]
+
+# Required attributes for module, separated by a comma
+required-attributes=
+
+# List of builtins function names that should not be used, separated by a comma
+bad-functions=map,filter,apply,input
+
+# Regular expression which should only match correct module names
+module-rgx=(([a-z_][a-z0-9_]*)|([A-Z][a-zA-Z0-9]+))$
+
+# Regular expression which should only match correct module level names
+const-rgx=(([A-Z_][A-Z0-9_]*)|(__.*__))$
+
+# Regular expression which should only match correct class names
+class-rgx=[A-Z_][a-zA-Z0-9]+$
+
+# Regular expression which should only match correct function names
+function-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct method names
+method-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct instance attribute names
+attr-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct argument names
+argument-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct variable names
+variable-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct attribute names in class
+# bodies
+class-attribute-rgx=([A-Za-z_][A-Za-z0-9_]{2,30}|(__.*__))$
+
+# Regular expression which should only match correct list comprehension /
+# generator expression variable names
+inlinevar-rgx=[A-Za-z_][A-Za-z0-9_]*$
+
+# Good variable names which should always be accepted, separated by a comma
+# f is a useful name for a file descriptor
+good-names=f,i,j,k,ex,Run,_
+
+# Bad variable names which should always be refused, separated by a comma
+bad-names=foo,bar,baz,toto,tutu,tata
+
+# Regular expression which should only match function or class names that do
+# not require a docstring.
+no-docstring-rgx=__.*__
+
+# Minimum line length for functions/classes that require docstrings, shorter
+# ones are exempt.
+docstring-min-length=-1
+
+
+[VARIABLES]
+
+# Tells whether we should check for unused import in __init__ files.
+init-import=no
+
+# A regular expression matching the beginning of the name of dummy variables
+# (i.e. not used).
+dummy-variables-rgx=_$|dummy
+
+# List of additional names supposed to be defined in builtins. Remember that
+# you should avoid to define new builtins when possible.
+additional-builtins=
+
+
+[FORMAT]
+
+# Maximum number of characters on a single line.
+max-line-length=79
+
+# Regexp for a line that is allowed to be longer than the limit.
+ignore-long-lines=^\s*(# )?<?https?://\S+>?$
+
+# Maximum number of lines in a module
+max-module-lines=1000
+
+# String used as indentation unit. This is usually " " (4 spaces) or "\t" (1
+# tab).
+indent-string='    '
+
+
+[TYPECHECK]
+
+# Tells whether missing members accessed in mixin class should be ignored. A
+# mixin class is detected if its name ends with "mixin" (case insensitive).
+ignore-mixin-members=yes
+
+# List of classes names for which member attributes should not be checked
+# (useful for classes with attributes dynamically set).
+ignored-classes=SQLObject
+
+# When zope mode is activated, add a predefined set of Zope acquired attributes
+# to generated-members.
+zope=no
+
+# List of members which are set dynamically and missed by pylint inference
+# system, and so shouldn't trigger E0201 when accessed. Python regular
+# expressions are accepted.
+generated-members=REQUEST,acl_users,aq_parent
+
+
+[CLASSES]
+
+# List of interface methods to ignore, separated by a comma. This is used for
+# instance to not check methods defines in Zope's Interface base class.
+ignore-iface-methods=isImplementedBy,deferred,extends,names,namesAndDescriptions,queryDescriptionFor,getBases,getDescriptionFor,getDoc,getName,getTaggedValue,getTaggedValueTags,isEqualOrExtendedBy,setTaggedValue,isImplementedByInstancesOf,adaptWith,is_implemented_by
+
+# List of method names used to declare (i.e. assign) instance attributes.
+defining-attr-methods=__init__,__new__,setUp
+
+# List of valid names for the first argument in a class method.
+valid-classmethod-first-arg=cls
+
+# List of valid names for the first argument in a metaclass class method.
+valid-metaclass-classmethod-first-arg=mcs
+
+
+[IMPORTS]
+
+# Deprecated modules which should not be used, separated by a comma
+deprecated-modules=regsub,TERMIOS,Bastion,rexec
+
+# Create a graph of every (i.e. internal and external) dependencies in the
+# given file (report RP0402 must not be disabled)
+import-graph=
+
+# Create a graph of external dependencies in the given file (report RP0402 must
+# not be disabled)
+ext-import-graph=
+
+# Create a graph of internal dependencies in the given file (report RP0402 must
+# not be disabled)
+int-import-graph=
+
+
+[DESIGN]
+
+# Maximum number of arguments for function / method
+max-args=5
+
+# Argument names that match this expression will be ignored. Default to name
+# with leading underscore
+ignored-argument-names=_.*
+
+# Maximum number of locals for function / method body
+max-locals=15
+
+# Maximum number of return / yield for function / method body
+max-returns=6
+
+# Maximum number of branch for function / method body
+max-branches=12
+
+# Maximum number of statements in function / method body
+max-statements=50
+
+# Maximum number of parents for a class (see R0901).
+max-parents=7
+
+# Maximum number of attributes for a class (see R0902).
+max-attributes=7
+
+# Minimum number of public methods for a class (see R0903).
+min-public-methods=2
+
+# Maximum number of public methods for a class (see R0904).
+max-public-methods=20
+
+
+[EXCEPTIONS]
+
+# Exceptions that will emit a warning when being caught. Defaults to
+# "Exception"
+overgeneral-exceptions=Exception

http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=f7f684602ff498d9f81e07c5fe37338c8a806a81

commit f7f684602ff498d9f81e07c5fe37338c8a806a81
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date:   Tue Oct 8 16:36:19 2013 +0530

    TMP: probes for math functions
    
    Temporary probes at various branch points in the functions.

diff --git a/sysdeps/ieee754/dbl-64/e_asin.c b/sysdeps/ieee754/dbl-64/e_asin.c
index 5bb5aeb..d425fd7 100644
--- a/sysdeps/ieee754/dbl-64/e_asin.c
+++ b/sysdeps/ieee754/dbl-64/e_asin.c
@@ -40,17 +40,18 @@
 #include "MathLib.h"
 #include "uasncs.h"
 #include <math_private.h>
+#include <stap-probe.h>
 
 #ifndef SECTION
 # define SECTION
 #endif
 
-void __doasin(double x, double dx, double w[]);
-void __dubsin(double x, double dx, double v[]);
-void __dubcos(double x, double dx, double v[]);
-void __docos(double x, double dx, double v[]);
-double __sin32(double x, double res, double res1);
-double __cos32(double x, double res, double res1);
+void __doasin (double x, double dx, double w[]);
+void __dubsin (double x, double dx, double v[]);
+void __dubcos (double x, double dx, double v[]);
+void __docos (double x, double dx, double v[]);
+double __sin32 (double x, double res, double res1);
+double __cos32 (double x, double res, double res1);
 
 /***************************************************************************/
 /* An ultimate asin routine. Given an IEEE double machine number x         */
@@ -58,584 +59,1044 @@ double __cos32(double x, double res, double res1);
 /***************************************************************************/
 double
 SECTION
-__ieee754_asin(double x){
-  double x1,x2,xx,s1,s2,res1,p,t,res,r,cor,cc,y,c,z,w[2];
-  mynumber u,v;
-  int4 k,m,n;
+__ieee754_asin (double x)
+{
+  double x1, x2, xx, s1, s2, res1, p, t, res, r, cor, cc, y, c, z, w[2];
+  mynumber u, v;
+  int4 k, m, n;
 
   u.x = x;
   m = u.i[HIGH_HALF];
-  k = 0x7fffffff&m;              /* no sign */
+  k = 0x7fffffff & m;		/* no sign */
 
-  if (k < 0x3e500000) return x;  /* for x->0 => sin(x)=x */
+  if (k < 0x3e500000)
+    return x;			/* for x->0 => sin(x)=x */
   /*----------------------2^-26 <= |x| < 2^ -3    -----------------*/
-  else
-  if (k < 0x3fc00000) {
-    x2 = x*x;
-    t = (((((f6*x2 + f5)*x2 + f4)*x2 + f3)*x2 + f2)*x2 + f1)*(x2*x);
-    res = x+t;         /*  res=arcsin(x) according to Taylor series  */
-    cor = (x-res)+t;
-    if (res == res+1.025*cor) return res;
-    else {
-      x1 = x+big;
-      xx = x*x;
-      x1 -= big;
-      x2 = x - x1;
-      p = x1*x1*x1;
-      s1 = a1.x*p;
-      s2 = ((((((c7*xx + c6)*xx + c5)*xx + c4)*xx + c3)*xx + c2)*xx*xx*x +
-	     ((a1.x+a2.x)*x2*x2+ 0.5*x1*x)*x2) + a2.x*p;
-      res1 = x+s1;
-      s2 = ((x-res1)+s1)+s2;
-      res = res1+s2;
-      cor = (res1-res)+s2;
-      if (res == res+1.00014*cor) return res;
-      else {
-	__doasin(x,0,w);
-	if (w[0]==(w[0]+1.00000001*w[1])) return w[0];
-	else {
-	  y=ABS(x);
-	  res=ABS(w[0]);
-	  res1=ABS(w[0]+1.1*w[1]);
-	  return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
-	}
-      }
+  else if (k < 0x3fc00000)
+    {
+      x2 = x * x;
+      t =
+	(((((f6 * x2 + f5) * x2 + f4) * x2 + f3) * x2 + f2) * x2 +
+	 f1) * (x2 * x);
+      res = x + t;		/*  res=arcsin(x) according to Taylor series  */
+      cor = (x - res) + t;
+      if (res == res + 1.025 * cor)
+        {
+	  LIBC_PROBE (asin_probe, 2, 1, &x);
+	  return res;
+	}
+      else
+	{
+	  x1 = x + big;
+	  xx = x * x;
+	  x1 -= big;
+	  x2 = x - x1;
+	  p = x1 * x1 * x1;
+	  s1 = a1.x * p;
+	  s2 =
+	    ((((((c7 * xx + c6) * xx + c5) * xx + c4) * xx + c3) * xx +
+	      c2) * xx * xx * x + ((a1.x + a2.x) * x2 * x2 +
+				   0.5 * x1 * x) * x2) + a2.x * p;
+	  res1 = x + s1;
+	  s2 = ((x - res1) + s1) + s2;
+	  res = res1 + s2;
+	  cor = (res1 - res) + s2;
+	  if (res == res + 1.00014 * cor)
+	    {
+	  LIBC_PROBE (asin_probe, 2, 2, &x);
+	    return res;
+	    }
+	  else
+	    {
+	      __doasin (x, 0, w);
+	      if (w[0] == (w[0] + 1.00000001 * w[1]))
+	      {
+	  LIBC_PROBE (asin_probe, 2, 3, &x);
+		return w[0];
+		}
+	      else
+		{
+		  y = ABS (x);
+		  res = ABS (w[0]);
+		  res1 = ABS (w[0] + 1.1 * w[1]);
+		  return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+								      res1);
+		}
+	    }
+	}
     }
-  }
   /*---------------------0.125 <= |x| < 0.5 -----------------------------*/
-  else if (k < 0x3fe00000) {
-    if (k<0x3fd00000) n = 11*((k&0x000fffff)>>15);
-    else n = 11*((k&0x000fffff)>>14)+352;
-    if (m>0) xx = x - asncs.x[n];
-    else xx = -x - asncs.x[n];
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+xx*(asncs.x[n+5]
-     +xx*asncs.x[n+6]))))+asncs.x[n+7];
-    t+=p;
-    res =asncs.x[n+8] +t;
-    cor = (asncs.x[n+8]-res)+t;
-    if (res == res+1.05*cor) return (m>0)?res:-res;
-    else {
-      r=asncs.x[n+8]+xx*asncs.x[n+9];
-      t=((asncs.x[n+8]-r)+xx*asncs.x[n+9])+(p+xx*asncs.x[n+10]);
-      res = r+t;
-      cor = (r-res)+t;
-      if (res == res+1.0005*cor) return (m>0)?res:-res;
-      else {
-	res1=res+1.1*cor;
-	z=0.5*(res1-res);
-	__dubsin(res,z,w);
-	z=(w[0]-ABS(x))+w[1];
-	if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
-	else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
-	else {
-	  y=ABS(x);
-	  return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
-	}
-      }
-    }
-  }    /*   else  if (k < 0x3fe00000)    */
+  else if (k < 0x3fe00000)
+    {
+      if (k < 0x3fd00000)
+	n = 11 * ((k & 0x000fffff) >> 15);
+      else
+	n = 11 * ((k & 0x000fffff) >> 14) + 352;
+      if (m > 0)
+	xx = x - asncs.x[n];
+      else
+	xx = -x - asncs.x[n];
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * asncs.x[n + 6])))) + asncs.x[n + 7];
+      t += p;
+      res = asncs.x[n + 8] + t;
+      cor = (asncs.x[n + 8] - res) + t;
+      if (res == res + 1.05 * cor)
+{
+	  LIBC_PROBE (asin_probe, 2, 4, &x);
+	return (m > 0) ? res : -res;
+	}
+      else
+	{
+	  r = asncs.x[n + 8] + xx * asncs.x[n + 9];
+	  t =
+	    ((asncs.x[n + 8] - r) + xx * asncs.x[n + 9]) + (p +
+							    xx * asncs.x[n +
+									 10]);
+	  res = r + t;
+	  cor = (r - res) + t;
+	  if (res == res + 1.0005 * cor)
+	  {
+	  LIBC_PROBE (asin_probe, 2, 5, &x);
+	    return (m > 0) ? res : -res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      __dubsin (res, z, w);
+	      z = (w[0] - ABS (x)) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 6, &x);
+		return (m > 0) ? min (res, res1) : -min (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 7, &x);
+		return (m > 0) ? max (res, res1) : -max (res, res1);
+		}
+	      else
+		{
+		  y = ABS (x);
+		  return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+								      res1);
+		}
+	    }
+	}
+    }				/*   else  if (k < 0x3fe00000)    */
   /*-------------------- 0.5 <= |x| < 0.75 -----------------------------*/
-  else
-  if (k < 0x3fe80000) {
-    n = 1056+((k&0x000fe000)>>11)*3;
-    if (m>0) xx = x - asncs.x[n];
-    else xx = -x - asncs.x[n];
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+xx*(asncs.x[n+5]
-	   +xx*(asncs.x[n+6]+xx*asncs.x[n+7])))))+asncs.x[n+8];
-    t+=p;
-    res =asncs.x[n+9] +t;
-    cor = (asncs.x[n+9]-res)+t;
-    if (res == res+1.01*cor) return (m>0)?res:-res;
-    else {
-      r=asncs.x[n+9]+xx*asncs.x[n+10];
-      t=((asncs.x[n+9]-r)+xx*asncs.x[n+10])+(p+xx*asncs.x[n+11]);
-      res = r+t;
-      cor = (r-res)+t;
-      if (res == res+1.0005*cor) return (m>0)?res:-res;
-      else {
-	res1=res+1.1*cor;
-	z=0.5*(res1-res);
-	__dubsin(res,z,w);
-	z=(w[0]-ABS(x))+w[1];
-	if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
-	else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
-	else {
-	  y=ABS(x);
-	  return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
-	}
-      }
-    }
-  }    /*   else  if (k < 0x3fe80000)    */
+  else if (k < 0x3fe80000)
+    {
+      n = 1056 + ((k & 0x000fe000) >> 11) * 3;
+      if (m > 0)
+	xx = x - asncs.x[n];
+      else
+	xx = -x - asncs.x[n];
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * (asncs.x[n + 6] +
+					   xx * asncs.x[n + 7]))))) +
+	asncs.x[n + 8];
+      t += p;
+      res = asncs.x[n + 9] + t;
+      cor = (asncs.x[n + 9] - res) + t;
+      if (res == res + 1.01 * cor)
+      {
+	  LIBC_PROBE (asin_probe, 2, 8, &x);
+	return (m > 0) ? res : -res;
+	}
+      else
+	{
+	  r = asncs.x[n + 9] + xx * asncs.x[n + 10];
+	  t =
+	    ((asncs.x[n + 9] - r) + xx * asncs.x[n + 10]) + (p +
+							     xx * asncs.x[n +
+									  11]);
+	  res = r + t;
+	  cor = (r - res) + t;
+	  if (res == res + 1.0005 * cor)
+	  {
+	  LIBC_PROBE (asin_probe, 2, 9, &x);
+	    return (m > 0) ? res : -res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      __dubsin (res, z, w);
+	      z = (w[0] - ABS (x)) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 10, &x);
+		return (m > 0) ? min (res, res1) : -min (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 11, &x);
+		return (m > 0) ? max (res, res1) : -max (res, res1);
+		}
+	      else
+		{
+		  y = ABS (x);
+		  return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+								      res1);
+		}
+	    }
+	}
+    }				/*   else  if (k < 0x3fe80000)    */
   /*--------------------- 0.75 <= |x|< 0.921875 ----------------------*/
-  else
-  if (k < 0x3fed8000) {
-    n = 992+((k&0x000fe000)>>13)*13;
-    if (m>0) xx = x - asncs.x[n];
-    else xx = -x - asncs.x[n];
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+xx*(asncs.x[n+5]
-     +xx*(asncs.x[n+6]+xx*(asncs.x[n+7]+xx*asncs.x[n+8]))))))+asncs.x[n+9];
-    t+=p;
-    res =asncs.x[n+10] +t;
-    cor = (asncs.x[n+10]-res)+t;
-    if (res == res+1.01*cor) return (m>0)?res:-res;
-    else {
-      r=asncs.x[n+10]+xx*asncs.x[n+11];
-      t=((asncs.x[n+10]-r)+xx*asncs.x[n+11])+(p+xx*asncs.x[n+12]);
-      res = r+t;
-      cor = (r-res)+t;
-      if (res == res+1.0008*cor) return (m>0)?res:-res;
-      else {
-	res1=res+1.1*cor;
-	z=0.5*(res1-res);
-	y=hp0.x-res;
-	z=((hp0.x-y)-res)+(hp1.x-z);
-	__dubcos(y,z,w);
-	z=(w[0]-ABS(x))+w[1];
-	if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
-	else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
-	else {
-	  y=ABS(x);
-	  return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
-	}
-      }
-    }
-  }    /*   else  if (k < 0x3fed8000)    */
+  else if (k < 0x3fed8000)
+    {
+      n = 992 + ((k & 0x000fe000) >> 13) * 13;
+      if (m > 0)
+	xx = x - asncs.x[n];
+      else
+	xx = -x - asncs.x[n];
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * (asncs.x[n + 6] +
+					   xx * (asncs.x[n + 7] +
+						 xx * asncs.x[n + 8])))))) +
+	asncs.x[n + 9];
+      t += p;
+      res = asncs.x[n + 10] + t;
+      cor = (asncs.x[n + 10] - res) + t;
+      if (res == res + 1.01 * cor)
+      {
+	  LIBC_PROBE (asin_probe, 2, 12, &x);
+	return (m > 0) ? res : -res;
+	}
+      else
+	{
+	  r = asncs.x[n + 10] + xx * asncs.x[n + 11];
+	  t =
+	    ((asncs.x[n + 10] - r) + xx * asncs.x[n + 11]) + (p +
+							      xx * asncs.x[n +
+									   12]);
+	  res = r + t;
+	  cor = (r - res) + t;
+	  if (res == res + 1.0008 * cor)
+	  {
+	  LIBC_PROBE (asin_probe, 2, 13, &x);
+	    return (m > 0) ? res : -res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      y = hp0.x - res;
+	      z = ((hp0.x - y) - res) + (hp1.x - z);
+	      __dubcos (y, z, w);
+	      z = (w[0] - ABS (x)) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 14, &x);
+		return (m > 0) ? min (res, res1) : -min (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 15, &x);
+		return (m > 0) ? max (res, res1) : -max (res, res1);
+		}
+	      else
+		{
+		  y = ABS (x);
+		  return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+								      res1);
+		}
+	    }
+	}
+    }				/*   else  if (k < 0x3fed8000)    */
   /*-------------------0.921875 <= |x| < 0.953125 ------------------------*/
-  else
-  if (k < 0x3fee8000) {
-    n = 884+((k&0x000fe000)>>13)*14;
-    if (m>0) xx = x - asncs.x[n];
-    else xx = -x - asncs.x[n];
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
-		      xx*(asncs.x[n+5]+xx*(asncs.x[n+6]
-		      +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+
-		      xx*asncs.x[n+9])))))))+asncs.x[n+10];
-    t+=p;
-    res =asncs.x[n+11] +t;
-    cor = (asncs.x[n+11]-res)+t;
-    if (res == res+1.01*cor) return (m>0)?res:-res;
-    else {
-      r=asncs.x[n+11]+xx*asncs.x[n+12];
-      t=((asncs.x[n+11]-r)+xx*asncs.x[n+12])+(p+xx*asncs.x[n+13]);
-      res = r+t;
-      cor = (r-res)+t;
-      if (res == res+1.0007*cor) return (m>0)?res:-res;
-      else {
-	res1=res+1.1*cor;
-	z=0.5*(res1-res);
-	y=(hp0.x-res)-z;
-	z=y+hp1.x;
-	y=(y-z)+hp1.x;
-	__dubcos(z,y,w);
-	z=(w[0]-ABS(x))+w[1];
-	if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
-	else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
-	else {
-	  y=ABS(x);
-	  return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
-	}
-      }
-    }
-  }    /*   else  if (k < 0x3fee8000)    */
+  else if (k < 0x3fee8000)
+    {
+      n = 884 + ((k & 0x000fe000) >> 13) * 14;
+      if (m > 0)
+	xx = x - asncs.x[n];
+      else
+	xx = -x - asncs.x[n];
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * (asncs.x[n + 6] +
+					   xx * (asncs.x[n + 7] +
+						 xx * (asncs.x[n + 8] +
+						       xx * asncs.x[n +
+								    9])))))))
+	+ asncs.x[n + 10];
+      t += p;
+      res = asncs.x[n + 11] + t;
+      cor = (asncs.x[n + 11] - res) + t;
+      if (res == res + 1.01 * cor)
+      {
+	  LIBC_PROBE (asin_probe, 2, 16, &x);
+	return (m > 0) ? res : -res;
+	}
+      else
+	{
+	  r = asncs.x[n + 11] + xx * asncs.x[n + 12];
+	  t =
+	    ((asncs.x[n + 11] - r) + xx * asncs.x[n + 12]) + (p +
+							      xx * asncs.x[n +
+									   13]);
+	  res = r + t;
+	  cor = (r - res) + t;
+	  if (res == res + 1.0007 * cor)
+	  {
+	  LIBC_PROBE (asin_probe, 2, 17, &x);
+	    return (m > 0) ? res : -res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      y = (hp0.x - res) - z;
+	      z = y + hp1.x;
+	      y = (y - z) + hp1.x;
+	      __dubcos (z, y, w);
+	      z = (w[0] - ABS (x)) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 18, &x);
+		return (m > 0) ? min (res, res1) : -min (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 19, &x);
+		return (m > 0) ? max (res, res1) : -max (res, res1);
+		}
+	      else
+		{
+		  y = ABS (x);
+		  return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+								      res1);
+		}
+	    }
+	}
+    }				/*   else  if (k < 0x3fee8000)    */
 
   /*--------------------0.953125 <= |x| < 0.96875 ------------------------*/
-  else
-  if (k < 0x3fef0000) {
-    n = 768+((k&0x000fe000)>>13)*15;
-    if (m>0) xx = x - asncs.x[n];
-    else xx = -x - asncs.x[n];
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
-			 xx*(asncs.x[n+5]+xx*(asncs.x[n+6]
-			 +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+
-		    xx*(asncs.x[n+9]+xx*asncs.x[n+10]))))))))+asncs.x[n+11];
-    t+=p;
-    res =asncs.x[n+12] +t;
-    cor = (asncs.x[n+12]-res)+t;
-    if (res == res+1.01*cor) return (m>0)?res:-res;
-    else {
-      r=asncs.x[n+12]+xx*asncs.x[n+13];
-      t=((asncs.x[n+12]-r)+xx*asncs.x[n+13])+(p+xx*asncs.x[n+14]);
-      res = r+t;
-      cor = (r-res)+t;
-      if (res == res+1.0007*cor) return (m>0)?res:-res;
-      else {
-	res1=res+1.1*cor;
-	z=0.5*(res1-res);
-	y=(hp0.x-res)-z;
-	z=y+hp1.x;
-	y=(y-z)+hp1.x;
-	__dubcos(z,y,w);
-	z=(w[0]-ABS(x))+w[1];
-	if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
-	else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
-	else {
-	  y=ABS(x);
-	  return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
-	}
-      }
-    }
-  }    /*   else  if (k < 0x3fef0000)    */
+  else if (k < 0x3fef0000)
+    {
+      n = 768 + ((k & 0x000fe000) >> 13) * 15;
+      if (m > 0)
+	xx = x - asncs.x[n];
+      else
+	xx = -x - asncs.x[n];
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * (asncs.x[n + 6] +
+					   xx * (asncs.x[n + 7] +
+						 xx * (asncs.x[n + 8] +
+						       xx * (asncs.x[n + 9] +
+							     xx * asncs.x[n +
+									  10]))))))))
+	+ asncs.x[n + 11];
+      t += p;
+      res = asncs.x[n + 12] + t;
+      cor = (asncs.x[n + 12] - res) + t;
+      if (res == res + 1.01 * cor)
+      {
+	  LIBC_PROBE (asin_probe, 2, 20, &x);
+	return (m > 0) ? res : -res;
+	}
+      else
+	{
+	  r = asncs.x[n + 12] + xx * asncs.x[n + 13];
+	  t =
+	    ((asncs.x[n + 12] - r) + xx * asncs.x[n + 13]) + (p +
+							      xx * asncs.x[n +
+									   14]);
+	  res = r + t;
+	  cor = (r - res) + t;
+	  if (res == res + 1.0007 * cor)
+	  {
+	  LIBC_PROBE (asin_probe, 2, 21, &x);
+	    return (m > 0) ? res : -res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      y = (hp0.x - res) - z;
+	      z = y + hp1.x;
+	      y = (y - z) + hp1.x;
+	      __dubcos (z, y, w);
+	      z = (w[0] - ABS (x)) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 22, &x);
+		return (m > 0) ? min (res, res1) : -min (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (asin_probe, 2, 23, &x);
+		return (m > 0) ? max (res, res1) : -max (res, res1);
+		}
+	      else
+		{
+		  y = ABS (x);
+		  return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+								      res1);
+		}
+	    }
+	}
+    }				/*   else  if (k < 0x3fef0000)    */
   /*--------------------0.96875 <= |x| < 1 --------------------------------*/
-  else
-  if (k<0x3ff00000)  {
-    z = 0.5*((m>0)?(1.0-x):(1.0+x));
-    v.x=z;
-    k=v.i[HIGH_HALF];
-    t=inroot[(k&0x001fffff)>>14]*powtwo[511-(k>>21)];
-    r=1.0-t*t*z;
-    t = t*(rt0+r*(rt1+r*(rt2+r*rt3)));
-    c=t*z;
-    t=c*(1.5-0.5*t*c);
-    y=(c+t24)-t24;
-    cc = (z-y*y)/(t+y);
-    p=(((((f6*z+f5)*z+f4)*z+f3)*z+f2)*z+f1)*z;
-    cor = (hp1.x - 2.0*cc)-2.0*(y+cc)*p;
-    res1 = hp0.x - 2.0*y;
-    res =res1 + cor;
-    if (res == res+1.003*((res1-res)+cor)) return (m>0)?res:-res;
-    else {
-      c=y+cc;
-      cc=(y-c)+cc;
-      __doasin(c,cc,w);
-      res1=hp0.x-2.0*w[0];
-      cor=((hp0.x-res1)-2.0*w[0])+(hp1.x-2.0*w[1]);
-      res = res1+cor;
-      cor = (res1-res)+cor;
-      if (res==(res+1.0000001*cor)) return (m>0)?res:-res;
-      else {
-	y=ABS(x);
-	res1=res+1.1*cor;
-	return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
-      }
-    }
-  }    /*   else  if (k < 0x3ff00000)    */
+  else if (k < 0x3ff00000)
+    {
+      z = 0.5 * ((m > 0) ? (1.0 - x) : (1.0 + x));
+      v.x = z;
+      k = v.i[HIGH_HALF];
+      t = inroot[(k & 0x001fffff) >> 14] * powtwo[511 - (k >> 21)];
+      r = 1.0 - t * t * z;
+      t = t * (rt0 + r * (rt1 + r * (rt2 + r * rt3)));
+      c = t * z;
+      t = c * (1.5 - 0.5 * t * c);
+      y = (c + t24) - t24;
+      cc = (z - y * y) / (t + y);
+      p = (((((f6 * z + f5) * z + f4) * z + f3) * z + f2) * z + f1) * z;
+      cor = (hp1.x - 2.0 * cc) - 2.0 * (y + cc) * p;
+      res1 = hp0.x - 2.0 * y;
+      res = res1 + cor;
+      if (res == res + 1.003 * ((res1 - res) + cor))
+      {
+	  LIBC_PROBE (asin_probe, 2, 24, &x);
+	return (m > 0) ? res : -res;
+	}
+      else
+	{
+	  c = y + cc;
+	  cc = (y - c) + cc;
+	  __doasin (c, cc, w);
+	  res1 = hp0.x - 2.0 * w[0];
+	  cor = ((hp0.x - res1) - 2.0 * w[0]) + (hp1.x - 2.0 * w[1]);
+	  res = res1 + cor;
+	  cor = (res1 - res) + cor;
+	  if (res == (res + 1.0000001 * cor))
+	  {
+	  LIBC_PROBE (asin_probe, 2, 25, &x);
+	    return (m > 0) ? res : -res;
+	    }
+	  else
+	    {
+	      y = ABS (x);
+	      res1 = res + 1.1 * cor;
+	      return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+								  res1);
+	    }
+	}
+    }				/*   else  if (k < 0x3ff00000)    */
   /*---------------------------- |x|>=1 -------------------------------*/
-  else if (k==0x3ff00000 && u.i[LOW_HALF]==0) return (m>0)?hp0.x:-hp0.x;
+  else if (k == 0x3ff00000 && u.i[LOW_HALF] == 0)
+    return (m > 0) ? hp0.x : -hp0.x;
+  else if (k > 0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0))
+    return x;
   else
-  if (k>0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0)) return x;
-  else {
-    u.i[HIGH_HALF]=0x7ff00000;
-    v.i[HIGH_HALF]=0x7ff00000;
-    u.i[LOW_HALF]=0;
-    v.i[LOW_HALF]=0;
-    return u.x/v.x;  /* NaN */
- }
+    {
+      u.i[HIGH_HALF] = 0x7ff00000;
+      v.i[HIGH_HALF] = 0x7ff00000;
+      u.i[LOW_HALF] = 0;
+      v.i[LOW_HALF] = 0;
+      return u.x / v.x;		/* NaN */
+    }
 }
+
 #ifndef __ieee754_asin
 strong_alias (__ieee754_asin, __asin_finite)
 #endif
-
 /*******************************************************************/
 /*                                                                 */
 /*         End of arcsine,  below is arccosine                     */
 /*                                                                 */
 /*******************************************************************/
-
 double
 SECTION
-__ieee754_acos(double x)
+__ieee754_acos (double x)
 {
-  double x1,x2,xx,s1,s2,res1,p,t,res,r,cor,cc,y,c,z,w[2],eps;
-  mynumber u,v;
-  int4 k,m,n;
+  double x1, x2, xx, s1, s2, res1, p, t, res, r, cor, cc, y, c, z, w[2], eps;
+  mynumber u, v;
+  int4 k, m, n;
   u.x = x;
   m = u.i[HIGH_HALF];
-  k = 0x7fffffff&m;
+  k = 0x7fffffff & m;
   /*-------------------  |x|<2.77556*10^-17 ----------------------*/
-  if (k < 0x3c880000) return hp0.x;
+  if (k < 0x3c880000)
+    return hp0.x;
 
   /*-----------------  2.77556*10^-17 <= |x| < 2^-3 --------------*/
-  else
-  if (k < 0x3fc00000) {
-    x2 = x*x;
-    t = (((((f6*x2 + f5)*x2 + f4)*x2 + f3)*x2 + f2)*x2 + f1)*(x2*x);
-    r=hp0.x-x;
-    cor=(((hp0.x-r)-x)+hp1.x)-t;
-    res = r+cor;
-    cor = (r-res)+cor;
-    if (res == res+1.004*cor) return res;
-    else {
-      x1 = x+big;
-      xx = x*x;
-      x1 -= big;
-      x2 = x - x1;
-      p = x1*x1*x1;
-      s1 = a1.x*p;
-      s2 = ((((((c7*xx + c6)*xx + c5)*xx + c4)*xx + c3)*xx + c2)*xx*xx*x +
-	    ((a1.x+a2.x)*x2*x2+ 0.5*x1*x)*x2) + a2.x*p;
-      res1 = x+s1;
-      s2 = ((x-res1)+s1)+s2;
-      r=hp0.x-res1;
-      cor=(((hp0.x-r)-res1)+hp1.x)-s2;
-      res = r+cor;
-      cor = (r-res)+cor;
-      if (res == res+1.00004*cor) return res;
-      else {
-	__doasin(x,0,w);
-	r=hp0.x-w[0];
-	cor=((hp0.x-r)-w[0])+(hp1.x-w[1]);
-	res=r+cor;
-	cor=(r-res)+cor;
-	if (res ==(res +1.00000001*cor)) return res;
-	else {
-	  res1=res+1.1*cor;
-	  return __cos32(x,res,res1);
-	}
-      }
-    }
-  }    /*   else  if (k < 0x3fc00000)    */
+  else if (k < 0x3fc00000)
+    {
+      x2 = x * x;
+      t =
+	(((((f6 * x2 + f5) * x2 + f4) * x2 + f3) * x2 + f2) * x2 +
+	 f1) * (x2 * x);
+      r = hp0.x - x;
+      cor = (((hp0.x - r) - x) + hp1.x) - t;
+      res = r + cor;
+      cor = (r - res) + cor;
+      if (res == res + 1.004 * cor)
+      {
+	  LIBC_PROBE (acos_probe, 2, 1, &x);
+	return res;
+	}
+      else
+	{
+	  x1 = x + big;
+	  xx = x * x;
+	  x1 -= big;
+	  x2 = x - x1;
+	  p = x1 * x1 * x1;
+	  s1 = a1.x * p;
+	  s2 =
+	    ((((((c7 * xx + c6) * xx + c5) * xx + c4) * xx + c3) * xx +
+	      c2) * xx * xx * x + ((a1.x + a2.x) * x2 * x2 +
+				   0.5 * x1 * x) * x2) + a2.x * p;
+	  res1 = x + s1;
+	  s2 = ((x - res1) + s1) + s2;
+	  r = hp0.x - res1;
+	  cor = (((hp0.x - r) - res1) + hp1.x) - s2;
+	  res = r + cor;
+	  cor = (r - res) + cor;
+	  if (res == res + 1.00004 * cor)
+	  {
+	  LIBC_PROBE (acos_probe, 2, 2, &x);
+	    return res;
+	    }
+	  else
+	    {
+	      __doasin (x, 0, w);
+	      r = hp0.x - w[0];
+	      cor = ((hp0.x - r) - w[0]) + (hp1.x - w[1]);
+	      res = r + cor;
+	      cor = (r - res) + cor;
+	      if (res == (res + 1.00000001 * cor))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 3, &x);
+		return res;
+		}
+	      else
+		{
+		  res1 = res + 1.1 * cor;
+		  return __cos32 (x, res, res1);
+		}
+	    }
+	}
+    }				/*   else  if (k < 0x3fc00000)    */
   /*----------------------  0.125 <= |x| < 0.5 --------------------*/
-  else
-  if (k < 0x3fe00000) {
-    if (k<0x3fd00000) n = 11*((k&0x000fffff)>>15);
-    else n = 11*((k&0x000fffff)>>14)+352;
-    if (m>0) xx = x - asncs.x[n];
-    else xx = -x - asncs.x[n];
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
-		   xx*(asncs.x[n+5]+xx*asncs.x[n+6]))))+asncs.x[n+7];
-    t+=p;
-    y = (m>0)?(hp0.x-asncs.x[n+8]):(hp0.x+asncs.x[n+8]);
-    t = (m>0)?(hp1.x-t):(hp1.x+t);
-    res = y+t;
-    if (res == res+1.02*((y-res)+t)) return res;
-    else {
-      r=asncs.x[n+8]+xx*asncs.x[n+9];
-      t=((asncs.x[n+8]-r)+xx*asncs.x[n+9])+(p+xx*asncs.x[n+10]);
-      if (m>0)
-	{p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; }
+  else if (k < 0x3fe00000)
+    {
+      if (k < 0x3fd00000)
+	n = 11 * ((k & 0x000fffff) >> 15);
       else
-	{p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); }
-      res = p+t;
-      cor = (p-res)+t;
-      if (res == (res+1.0002*cor)) return res;
-      else {
-	res1=res+1.1*cor;
-	z=0.5*(res1-res);
-	__docos(res,z,w);
-	z=(w[0]-x)+w[1];
-	if (z>1.0e-27) return max(res,res1);
-	else if (z<-1.0e-27) return min(res,res1);
-	else return __cos32(x,res,res1);
-      }
-    }
-  }    /*   else  if (k < 0x3fe00000)    */
+	n = 11 * ((k & 0x000fffff) >> 14) + 352;
+      if (m > 0)
+	xx = x - asncs.x[n];
+      else
+	xx = -x - asncs.x[n];
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * asncs.x[n + 6])))) + asncs.x[n + 7];
+      t += p;
+      y = (m > 0) ? (hp0.x - asncs.x[n + 8]) : (hp0.x + asncs.x[n + 8]);
+      t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+      res = y + t;
+      if (res == res + 1.02 * ((y - res) + t))
+      {
+	  LIBC_PROBE (acos_probe, 2, 4, &x);
+	return res;
+	}
+      else
+	{
+	  r = asncs.x[n + 8] + xx * asncs.x[n + 9];
+	  t =
+	    ((asncs.x[n + 8] - r) + xx * asncs.x[n + 9]) + (p +
+							    xx * asncs.x[n +
+									 10]);
+	  if (m > 0)
+	    {
+	      p = hp0.x - r;
+	      t = (((hp0.x - p) - r) - t) + hp1.x;
+	    }
+	  else
+	    {
+	      p = hp0.x + r;
+	      t = ((hp0.x - p) + r) + (hp1.x + t);
+	    }
+	  res = p + t;
+	  cor = (p - res) + t;
+	  if (res == (res + 1.0002 * cor))
+	  {
+	  LIBC_PROBE (acos_probe, 2, 5, &x);
+	    return res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      __docos (res, z, w);
+	      z = (w[0] - x) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 6, &x);
+		return max (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 7, &x);
+		return min (res, res1);
+		}
+	      else
+		return __cos32 (x, res, res1);
+	    }
+	}
+    }				/*   else  if (k < 0x3fe00000)    */
 
   /*--------------------------- 0.5 <= |x| < 0.75 ---------------------*/
-  else
-  if (k < 0x3fe80000) {
-    n = 1056+((k&0x000fe000)>>11)*3;
-    if (m>0) {xx = x - asncs.x[n]; eps=1.04; }
-    else {xx = -x - asncs.x[n]; eps=1.02; }
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
-		   xx*(asncs.x[n+5]+xx*(asncs.x[n+6]+
-		   xx*asncs.x[n+7])))))+asncs.x[n+8];
-    t+=p;
-   y = (m>0)?(hp0.x-asncs.x[n+9]):(hp0.x+asncs.x[n+9]);
-   t = (m>0)?(hp1.x-t):(hp1.x+t);
-   res = y+t;
-   if (res == res+eps*((y-res)+t)) return res;
-   else {
-     r=asncs.x[n+9]+xx*asncs.x[n+10];
-     t=((asncs.x[n+9]-r)+xx*asncs.x[n+10])+(p+xx*asncs.x[n+11]);
-     if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0004; }
-     else   {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0002; }
-     res = p+t;
-     cor = (p-res)+t;
-     if (res == (res+eps*cor)) return res;
-     else {
-       res1=res+1.1*cor;
-       z=0.5*(res1-res);
-       __docos(res,z,w);
-       z=(w[0]-x)+w[1];
-       if (z>1.0e-27) return max(res,res1);
-       else if (z<-1.0e-27) return min(res,res1);
-       else return __cos32(x,res,res1);
-     }
-   }
-  }    /*   else  if (k < 0x3fe80000)    */
+  else if (k < 0x3fe80000)
+    {
+      n = 1056 + ((k & 0x000fe000) >> 11) * 3;
+      if (m > 0)
+	{
+	  xx = x - asncs.x[n];
+	  eps = 1.04;
+	}
+      else
+	{
+	  xx = -x - asncs.x[n];
+	  eps = 1.02;
+	}
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * (asncs.x[n + 6] +
+					   xx * asncs.x[n + 7]))))) +
+	asncs.x[n + 8];
+      t += p;
+      y = (m > 0) ? (hp0.x - asncs.x[n + 9]) : (hp0.x + asncs.x[n + 9]);
+      t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+      res = y + t;
+      if (res == res + eps * ((y - res) + t))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 8, &x);
+	return res;
+	}
+      else
+	{
+	  r = asncs.x[n + 9] + xx * asncs.x[n + 10];
+	  t =
+	    ((asncs.x[n + 9] - r) + xx * asncs.x[n + 10]) + (p +
+							     xx * asncs.x[n +
+									  11]);
+	  if (m > 0)
+	    {
+	      p = hp0.x - r;
+	      t = (((hp0.x - p) - r) - t) + hp1.x;
+	      eps = 1.0004;
+	    }
+	  else
+	    {
+	      p = hp0.x + r;
+	      t = ((hp0.x - p) + r) + (hp1.x + t);
+	      eps = 1.0002;
+	    }
+	  res = p + t;
+	  cor = (p - res) + t;
+	  if (res == (res + eps * cor))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 9, &x);
+	    return res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      __docos (res, z, w);
+	      z = (w[0] - x) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 10, &x);
+		return max (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 11, &x);
+		return min (res, res1);
+		}
+	      else
+		return __cos32 (x, res, res1);
+	    }
+	}
+    }				/*   else  if (k < 0x3fe80000)    */
 
 /*------------------------- 0.75 <= |x| < 0.921875 -------------*/
-  else
-  if (k < 0x3fed8000) {
-    n = 992+((k&0x000fe000)>>13)*13;
-    if (m>0) {xx = x - asncs.x[n]; eps = 1.04; }
-    else {xx = -x - asncs.x[n]; eps = 1.01; }
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
-		      xx*(asncs.x[n+5]+xx*(asncs.x[n+6]+xx*(asncs.x[n+7]+
-		      xx*asncs.x[n+8]))))))+asncs.x[n+9];
-    t+=p;
-    y = (m>0)?(hp0.x-asncs.x[n+10]):(hp0.x+asncs.x[n+10]);
-    t = (m>0)?(hp1.x-t):(hp1.x+t);
-    res = y+t;
-    if (res == res+eps*((y-res)+t)) return res;
-    else {
-      r=asncs.x[n+10]+xx*asncs.x[n+11];
-      t=((asncs.x[n+10]-r)+xx*asncs.x[n+11])+(p+xx*asncs.x[n+12]);
-      if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0032; }
-      else   {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0008; }
-      res = p+t;
-      cor = (p-res)+t;
-      if (res == (res+eps*cor)) return res;
-      else {
-	res1=res+1.1*cor;
-	z=0.5*(res1-res);
-	__docos(res,z,w);
-	z=(w[0]-x)+w[1];
-	if (z>1.0e-27) return max(res,res1);
-	else if (z<-1.0e-27) return min(res,res1);
-	else return __cos32(x,res,res1);
-      }
-    }
-  }    /*   else  if (k < 0x3fed8000)    */
+  else if (k < 0x3fed8000)
+    {
+      n = 992 + ((k & 0x000fe000) >> 13) * 13;
+      if (m > 0)
+	{
+	  xx = x - asncs.x[n];
+	  eps = 1.04;
+	}
+      else
+	{
+	  xx = -x - asncs.x[n];
+	  eps = 1.01;
+	}
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * (asncs.x[n + 6] +
+					   xx * (asncs.x[n + 7] +
+						 xx * asncs.x[n + 8])))))) +
+	asncs.x[n + 9];
+      t += p;
+      y = (m > 0) ? (hp0.x - asncs.x[n + 10]) : (hp0.x + asncs.x[n + 10]);
+      t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+      res = y + t;
+      if (res == res + eps * ((y - res) + t))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 12, &x);
+	return res;
+	}
+      else
+	{
+	  r = asncs.x[n + 10] + xx * asncs.x[n + 11];
+	  t =
+	    ((asncs.x[n + 10] - r) + xx * asncs.x[n + 11]) + (p +
+							      xx * asncs.x[n +
+									   12]);
+	  if (m > 0)
+	    {
+	      p = hp0.x - r;
+	      t = (((hp0.x - p) - r) - t) + hp1.x;
+	      eps = 1.0032;
+	    }
+	  else
+	    {
+	      p = hp0.x + r;
+	      t = ((hp0.x - p) + r) + (hp1.x + t);
+	      eps = 1.0008;
+	    }
+	  res = p + t;
+	  cor = (p - res) + t;
+	  if (res == (res + eps * cor))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 13, &x);
+	    return res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      __docos (res, z, w);
+	      z = (w[0] - x) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 14, &x);
+		return max (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 15, &x);
+		return min (res, res1);
+		}
+	      else
+		return __cos32 (x, res, res1);
+	    }
+	}
+    }				/*   else  if (k < 0x3fed8000)    */
 
 /*-------------------0.921875 <= |x| < 0.953125 ------------------*/
-  else
-  if (k < 0x3fee8000) {
-    n = 884+((k&0x000fe000)>>13)*14;
-    if (m>0) {xx = x - asncs.x[n]; eps=1.04; }
-    else {xx = -x - asncs.x[n]; eps =1.005; }
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
-		   xx*(asncs.x[n+5]+xx*(asncs.x[n+6]
-		   +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+
-		   xx*asncs.x[n+9])))))))+asncs.x[n+10];
-    t+=p;
-    y = (m>0)?(hp0.x-asncs.x[n+11]):(hp0.x+asncs.x[n+11]);
-    t = (m>0)?(hp1.x-t):(hp1.x+t);
-    res = y+t;
-    if (res == res+eps*((y-res)+t)) return res;
-    else {
-      r=asncs.x[n+11]+xx*asncs.x[n+12];
-      t=((asncs.x[n+11]-r)+xx*asncs.x[n+12])+(p+xx*asncs.x[n+13]);
-      if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0030; }
-      else   {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0005; }
-      res = p+t;
-      cor = (p-res)+t;
-      if (res == (res+eps*cor)) return res;
-      else {
-	res1=res+1.1*cor;
-	z=0.5*(res1-res);
-	__docos(res,z,w);
-	z=(w[0]-x)+w[1];
-	if (z>1.0e-27) return max(res,res1);
-	else if (z<-1.0e-27) return min(res,res1);
-	else return __cos32(x,res,res1);
-      }
-    }
-  }    /*   else  if (k < 0x3fee8000)    */
+  else if (k < 0x3fee8000)
+    {
+      n = 884 + ((k & 0x000fe000) >> 13) * 14;
+      if (m > 0)
+	{
+	  xx = x - asncs.x[n];
+	  eps = 1.04;
+	}
+      else
+	{
+	  xx = -x - asncs.x[n];
+	  eps = 1.005;
+	}
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * (asncs.x[n + 6] +
+					   xx * (asncs.x[n + 7] +
+						 xx * (asncs.x[n + 8] +
+						       xx * asncs.x[n +
+								    9])))))))
+	+ asncs.x[n + 10];
+      t += p;
+      y = (m > 0) ? (hp0.x - asncs.x[n + 11]) : (hp0.x + asncs.x[n + 11]);
+      t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+      res = y + t;
+      if (res == res + eps * ((y - res) + t))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 16, &x);
+	return res;
+	}
+      else
+	{
+	  r = asncs.x[n + 11] + xx * asncs.x[n + 12];
+	  t =
+	    ((asncs.x[n + 11] - r) + xx * asncs.x[n + 12]) + (p +
+							      xx * asncs.x[n +
+									   13]);
+	  if (m > 0)
+	    {
+	      p = hp0.x - r;
+	      t = (((hp0.x - p) - r) - t) + hp1.x;
+	      eps = 1.0030;
+	    }
+	  else
+	    {
+	      p = hp0.x + r;
+	      t = ((hp0.x - p) + r) + (hp1.x + t);
+	      eps = 1.0005;
+	    }
+	  res = p + t;
+	  cor = (p - res) + t;
+	  if (res == (res + eps * cor))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 17, &x);
+	    return res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      __docos (res, z, w);
+	      z = (w[0] - x) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 18, &x);
+		return max (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 19, &x);
+		return min (res, res1);
+		}
+	      else
+		return __cos32 (x, res, res1);
+	    }
+	}
+    }				/*   else  if (k < 0x3fee8000)    */
 
   /*--------------------0.953125 <= |x| < 0.96875 ----------------*/
-  else
-  if (k < 0x3fef0000) {
-    n = 768+((k&0x000fe000)>>13)*15;
-    if (m>0) {xx = x - asncs.x[n]; eps=1.04; }
-    else {xx = -x - asncs.x[n]; eps=1.005;}
-    t = asncs.x[n+1]*xx;
-    p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
-	    xx*(asncs.x[n+5]+xx*(asncs.x[n+6]
-	    +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+xx*(asncs.x[n+9]+
-	    xx*asncs.x[n+10]))))))))+asncs.x[n+11];
-    t+=p;
-    y = (m>0)?(hp0.x-asncs.x[n+12]):(hp0.x+asncs.x[n+12]);
-   t = (m>0)?(hp1.x-t):(hp1.x+t);
-   res = y+t;
-   if (res == res+eps*((y-res)+t)) return res;
-   else {
-     r=asncs.x[n+12]+xx*asncs.x[n+13];
-     t=((asncs.x[n+12]-r)+xx*asncs.x[n+13])+(p+xx*asncs.x[n+14]);
-     if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0030; }
-     else   {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0005; }
-     res = p+t;
-     cor = (p-res)+t;
-     if (res == (res+eps*cor)) return res;
-     else {
-       res1=res+1.1*cor;
-       z=0.5*(res1-res);
-       __docos(res,z,w);
-       z=(w[0]-x)+w[1];
-       if (z>1.0e-27) return max(res,res1);
-       else if (z<-1.0e-27) return min(res,res1);
-       else return __cos32(x,res,res1);
-     }
-   }
-  }    /*   else  if (k < 0x3fef0000)    */
+  else if (k < 0x3fef0000)
+    {
+      n = 768 + ((k & 0x000fe000) >> 13) * 15;
+      if (m > 0)
+	{
+	  xx = x - asncs.x[n];
+	  eps = 1.04;
+	}
+      else
+	{
+	  xx = -x - asncs.x[n];
+	  eps = 1.005;
+	}
+      t = asncs.x[n + 1] * xx;
+      p =
+	xx * xx * (asncs.x[n + 2] +
+		   xx * (asncs.x[n + 3] +
+			 xx * (asncs.x[n + 4] +
+			       xx * (asncs.x[n + 5] +
+				     xx * (asncs.x[n + 6] +
+					   xx * (asncs.x[n + 7] +
+						 xx * (asncs.x[n + 8] +
+						       xx * (asncs.x[n + 9] +
+							     xx * asncs.x[n +
+									  10]))))))))
+	+ asncs.x[n + 11];
+      t += p;
+      y = (m > 0) ? (hp0.x - asncs.x[n + 12]) : (hp0.x + asncs.x[n + 12]);
+      t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+      res = y + t;
+      if (res == res + eps * ((y - res) + t))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 20, &x);
+	return res;
+	}
+      else
+	{
+	  r = asncs.x[n + 12] + xx * asncs.x[n + 13];
+	  t =
+	    ((asncs.x[n + 12] - r) + xx * asncs.x[n + 13]) + (p +
+							      xx * asncs.x[n +
+									   14]);
+	  if (m > 0)
+	    {
+	      p = hp0.x - r;
+	      t = (((hp0.x - p) - r) - t) + hp1.x;
+	      eps = 1.0030;
+	    }
+	  else
+	    {
+	      p = hp0.x + r;
+	      t = ((hp0.x - p) + r) + (hp1.x + t);
+	      eps = 1.0005;
+	    }
+	  res = p + t;
+	  cor = (p - res) + t;
+	  if (res == (res + eps * cor))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 21, &x);
+	    return res;
+	    }
+	  else
+	    {
+	      res1 = res + 1.1 * cor;
+	      z = 0.5 * (res1 - res);
+	      __docos (res, z, w);
+	      z = (w[0] - x) + w[1];
+	      if (z > 1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 22, &x);
+		return max (res, res1);
+		}
+	      else if (z < -1.0e-27)
+	      {
+	  LIBC_PROBE (acos_probe, 2, 23, &x);
+		return min (res, res1);
+		}
+	      else
+		return __cos32 (x, res, res1);
+	    }
+	}
+    }				/*   else  if (k < 0x3fef0000)    */
   /*-----------------0.96875 <= |x| < 1 ---------------------------*/
 
-  else
-  if (k<0x3ff00000)  {
-    z = 0.5*((m>0)?(1.0-x):(1.0+x));
-    v.x=z;
-    k=v.i[HIGH_HALF];
-    t=inroot[(k&0x001fffff)>>14]*powtwo[511-(k>>21)];
-    r=1.0-t*t*z;
-    t = t*(rt0+r*(rt1+r*(rt2+r*rt3)));
-    c=t*z;
-    t=c*(1.5-0.5*t*c);
-    y = (t27*c+c)-t27*c;
-    cc = (z-y*y)/(t+y);
-    p=(((((f6*z+f5)*z+f4)*z+f3)*z+f2)*z+f1)*z;
-    if (m<0) {
-      cor = (hp1.x - cc)-(y+cc)*p;
-      res1 = hp0.x - y;
-      res =res1 + cor;
-      if (res == res+1.002*((res1-res)+cor)) return (res+res);
-      else {
-	c=y+cc;
-	cc=(y-c)+cc;
-	__doasin(c,cc,w);
-	res1=hp0.x-w[0];
-	cor=((hp0.x-res1)-w[0])+(hp1.x-w[1]);
-	res = res1+cor;
-	cor = (res1-res)+cor;
-	if (res==(res+1.000001*cor)) return (res+res);
-	else {
-	  res=res+res;
-	  res1=res+1.2*cor;
-	  return __cos32(x,res,res1);
-	}
-      }
-    }
-    else {
-      cor = cc+p*(y+cc);
-      res = y + cor;
-      if (res == res+1.03*((y-res)+cor)) return (res+res);
-      else {
-	c=y+cc;
-	cc=(y-c)+cc;
-	__doasin(c,cc,w);
-	res = w[0];
-	cor=w[1];
-	if (res==(res+1.000001*cor)) return (res+res);
-	else {
-	  res=res+res;
-	  res1=res+1.2*cor;
-	  return __cos32(x,res,res1);
-	}
-      }
-    }
-  }    /*   else  if (k < 0x3ff00000)    */
+  else if (k < 0x3ff00000)
+    {
+      z = 0.5 * ((m > 0) ? (1.0 - x) : (1.0 + x));
+      v.x = z;
+      k = v.i[HIGH_HALF];
+      t = inroot[(k & 0x001fffff) >> 14] * powtwo[511 - (k >> 21)];
+      r = 1.0 - t * t * z;
+      t = t * (rt0 + r * (rt1 + r * (rt2 + r * rt3)));
+      c = t * z;
+      t = c * (1.5 - 0.5 * t * c);
+      y = (t27 * c + c) - t27 * c;
+      cc = (z - y * y) / (t + y);
+      p = (((((f6 * z + f5) * z + f4) * z + f3) * z + f2) * z + f1) * z;
+      if (m < 0)
+	{
+	  cor = (hp1.x - cc) - (y + cc) * p;
+	  res1 = hp0.x - y;
+	  res = res1 + cor;
+	  if (res == res + 1.002 * ((res1 - res) + cor))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 24, &x);
+	    return (res + res);
+	    }
+	  else
+	    {
+	      c = y + cc;
+	      cc = (y - c) + cc;
+	      __doasin (c, cc, w);
+	      res1 = hp0.x - w[0];
+	      cor = ((hp0.x - res1) - w[0]) + (hp1.x - w[1]);
+	      res = res1 + cor;
+	      cor = (res1 - res) + cor;
+	      if (res == (res + 1.000001 * cor))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 25, &x);
+		return (res + res);
+		}
+	      else
+		{
+		  res = res + res;
+		  res1 = res + 1.2 * cor;
+		  return __cos32 (x, res, res1);
+		}
+	    }
+	}
+      else
+	{
+	  cor = cc + p * (y + cc);
+	  res = y + cor;
+	  if (res == res + 1.03 * ((y - res) + cor))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 26, &x);
+	    return (res + res);
+	    }
+	  else
+	    {
+	      c = y + cc;
+	      cc = (y - c) + cc;
+	      __doasin (c, cc, w);
+	      res = w[0];
+	      cor = w[1];
+	      if (res == (res + 1.000001 * cor))
+	      {
+	  LIBC_PROBE (acos_probe, 2, 27, &x);
+		return (res + res);
+		}
+	      else
+		{
+		  res = res + res;
+		  res1 = res + 1.2 * cor;
+		  return __cos32 (x, res, res1);
+		}
+	    }
+	}
+    }				/*   else  if (k < 0x3ff00000)    */
 
   /*---------------------------- |x|>=1 -----------------------*/
+  else if (k == 0x3ff00000 && u.i[LOW_HALF] == 0)
+    return (m > 0) ? 0 : 2.0 * hp0.x;
+  else if (k > 0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0))
+    return x;
   else
-  if (k==0x3ff00000 && u.i[LOW_HALF]==0) return (m>0)?0:2.0*hp0.x;
-  else
-  if (k>0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0)) return x;
-  else {
-    u.i[HIGH_HALF]=0x7ff00000;
-    v.i[HIGH_HALF]=0x7ff00000;
-    u.i[LOW_HALF]=0;
-    v.i[LOW_HALF]=0;
-    return u.x/v.x;
-  }
+    {
+      u.i[HIGH_HALF] = 0x7ff00000;
+      v.i[HIGH_HALF] = 0x7ff00000;
+      u.i[LOW_HALF] = 0;
+      v.i[LOW_HALF] = 0;
+      return u.x / v.x;
+    }
 }
+
 #ifndef __ieee754_acos
 strong_alias (__ieee754_acos, __acos_finite)
 #endif
diff --git a/sysdeps/ieee754/dbl-64/e_atanh.c b/sysdeps/ieee754/dbl-64/e_atanh.c
index 21bb990..c12473f 100644
--- a/sysdeps/ieee754/dbl-64/e_atanh.c
+++ b/sysdeps/ieee754/dbl-64/e_atanh.c
@@ -38,6 +38,7 @@
 #include <inttypes.h>
 #include <math.h>
 #include <math_private.h>
+#include <stap-probe.h>
 
 static const double huge = 1e300;
 
@@ -56,9 +57,13 @@ __ieee754_atanh (double x)
 
       t = xa + xa;
       t = 0.5 * __log1p (t + t * xa / (1.0 - xa));
+      LIBC_PROBE (atanh_probe, 2, 1, &x);
     }
   else if (__builtin_expect (isless (xa, 1.0), 1))
+  {
+    LIBC_PROBE (atanh_probe, 2, 2, &x);
     t = 0.5 * __log1p ((xa + xa) / (1.0 - xa));
+    }
   else
     {
       if (isgreater (xa, 1.0))
diff --git a/sysdeps/ieee754/dbl-64/e_cosh.c b/sysdeps/ieee754/dbl-64/e_cosh.c
index 6caf943..798591d 100644
--- a/sysdeps/ieee754/dbl-64/e_cosh.c
+++ b/sysdeps/ieee754/dbl-64/e_cosh.c
@@ -33,6 +33,7 @@
 
 #include <math.h>
 #include <math_private.h>
+#include <stap-probe.h>
 
 static const double one = 1.0, half = 0.5, huge = 1.0e300;
 
@@ -55,11 +56,13 @@ __ieee754_cosh (double x)
 	{
 	  t = __expm1 (fabs (x));
 	  w = one + t;
+	  LIBC_PROBE (cosh_probe, 2, 1, &x);
 	  if (ix < 0x3c800000)
 	    return w;                                   /* cosh(tiny) = 1 */
 	  return one + (t * t) / (w + w);
 	}
 
+	  LIBC_PROBE (cosh_probe, 2, 2, &x);
       /* |x| in [0.5*ln2,22], return (exp(|x|)+1/exp(|x|)/2; */
       t = __ieee754_exp (fabs (x));
       return half * t + half / t;
@@ -67,7 +70,10 @@ __ieee754_cosh (double x)
 
   /* |x| in [22, log(maxdouble)] return half*exp(|x|) */
   if (ix < 0x40862e42)
+  {
+	  LIBC_PROBE (cosh_probe, 2, 3, &x);
     return half * __ieee754_exp (fabs (x));
+    }
 
   /* |x| in [log(maxdouble), overflowthresold] */
   GET_LOW_WORD (lx, x);
@@ -75,6 +81,7 @@ __ieee754_cosh (double x)
     {
       w = __ieee754_exp (half * fabs (x));
       t = half * w;
+	  LIBC_PROBE (cosh_probe, 2, 4, &x);
       return t * w;
     }
 
diff --git a/sysdeps/ieee754/dbl-64/e_pow.c b/sysdeps/ieee754/dbl-64/e_pow.c
index 1c5f4b3..4664f7d 100644
--- a/sysdeps/ieee754/dbl-64/e_pow.c
+++ b/sysdeps/ieee754/dbl-64/e_pow.c
@@ -42,6 +42,7 @@
 #include "upow.tbl"
 #include <math_private.h>
 #include <fenv.h>
+#include <stap-probe.h>
 
 #ifndef SECTION
 # define SECTION
@@ -65,6 +66,7 @@ __ieee754_pow (double x, double y)
   double z, a, aa, error, t, a1, a2, y1, y2;
   mynumber u, v;
   int k;
+  int retcode = -1;
   int4 qx, qy;
   v.x = y;
   u.x = x;
@@ -110,7 +112,16 @@ __ieee754_pow (double x, double y)
       a2 = (a - a1) + aa;
       error = error * ABS (y);
       t = __exp1 (a1, a2, 1.9e16 * error);	/* return -10 or 0 if wasn't computed exactly */
-      retval = (t > 0) ? t : power1 (x, y);
+      if (t > 0)
+        {
+	  retval = t;
+      retcode = 1;
+      LIBC_PROBE (pow_probe, 3, &x, &y, &retcode);
+	}
+      else
+        {
+	  retval = power1 (x, y);
+	}
 
       return retval;
     }
@@ -140,6 +151,8 @@ __ieee754_pow (double x, double y)
   /* if x<0 */
   if (u.i[HIGH_HALF] < 0)
     {
+      retcode = 2;
+      LIBC_PROBE (pow_probe, 3, &x, &y, &retcode);
       k = checkint (y);
       if (k == 0)
 	{
@@ -199,6 +212,7 @@ static double
 SECTION
 power1 (double x, double y)
 {
+  int retcode = 3;
   double z, a, aa, error, t, a1, a2, y1, y2;
   z = my_log2 (x, &aa, &error);
   t = y * CN;
@@ -213,7 +227,13 @@ power1 (double x, double y)
   a2 = (a - a1) + aa;
   error = error * ABS (y);
   t = __exp1 (a1, a2, 1.9e16 * error);
-  return (t >= 0) ? t : __slowpow (x, y, z);
+  if (t >= 0)
+    {
+      LIBC_PROBE (pow_probe, 3, &x, &y, &retcode);
+      return t;
+    }
+  else
+    return __slowpow (x, y, z);
 }
 
 /* Compute log(x) (x is left argument). The result is the returned double + the
diff --git a/sysdeps/ieee754/dbl-64/e_sinh.c b/sysdeps/ieee754/dbl-64/e_sinh.c
index 851b510..f3e1a8f 100644
--- a/sysdeps/ieee754/dbl-64/e_sinh.c
+++ b/sysdeps/ieee754/dbl-64/e_sinh.c
@@ -34,6 +34,7 @@ static char rcsid[] = "$NetBSD: e_sinh.c,v 1.7 1995/05/10 20:46:13 jtc Exp $";
 
 #include <math.h>
 #include <math_private.h>
+#include <stap-probe.h>
 
 static const double one = 1.0, shuge = 1.0e307;
 
@@ -63,6 +64,7 @@ __ieee754_sinh (double x)
 	  return x;
       /* sinh(tiny) = tiny with inexact */
       t = __expm1 (fabs (x));
+	  LIBC_PROBE (sinh_probe, 2, 1, &x);
       if (ix < 0x3ff00000)
 	return h * (2.0 * t - t * t / (t + one));
       return h * (t + t / (t + one));
@@ -70,12 +72,16 @@ __ieee754_sinh (double x)
 
   /* |x| in [22, log(maxdouble)] return 0.5*exp(|x|) */
   if (ix < 0x40862e42)
+  {
+	  LIBC_PROBE (sinh_probe, 2, 2, &x);
     return h * __ieee754_exp (fabs (x));
+    }
 
   /* |x| in [log(maxdouble), overflowthresold] */
   GET_LOW_WORD (lx, x);
   if (ix < 0x408633ce || ((ix == 0x408633ce) && (lx <= (u_int32_t) 0x8fb9f87d)))
     {
+	  LIBC_PROBE (sinh_probe, 2, 3, &x);
       w = __ieee754_exp (0.5 * fabs (x));
       t = h * w;
       return t * w;
diff --git a/sysdeps/ieee754/dbl-64/s_asinh.c b/sysdeps/ieee754/dbl-64/s_asinh.c
index 5500746..143122b 100644
--- a/sysdeps/ieee754/dbl-64/s_asinh.c
+++ b/sysdeps/ieee754/dbl-64/s_asinh.c
@@ -23,6 +23,7 @@
 
 #include <math.h>
 #include <math_private.h>
+#include <stap-probe.h>
 
 static const double
   one = 1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
@@ -46,6 +47,7 @@ __asinh (double x)
       if (ix >= 0x7ff00000)
 	return x + x;                           /* x is inf or NaN */
       w = __ieee754_log (fabs (x)) + ln2;
+      LIBC_PROBE (asinh_probe, 2, 1, &x);
     }
   else
     {
@@ -54,11 +56,13 @@ __asinh (double x)
 	{
 	  w = __ieee754_log (2.0 * xa + one / (__ieee754_sqrt (xa * xa + one) +
               xa));
+	  LIBC_PROBE (asinh_probe, 2, 2, &x);
 	}
       else                      /* 2.0 > |x| > 2**-28 */
 	{
 	  double t = xa * xa;
 	  w = __log1p (xa + t / (one + __ieee754_sqrt (one + t)));
+	  LIBC_PROBE (asinh_probe, 2, 3, &x);
 	}
     }
   return __copysign (w, x);
diff --git a/sysdeps/ieee754/dbl-64/s_atan.c b/sysdeps/ieee754/dbl-64/s_atan.c
index 0aa145c..456ffea 100644
--- a/sysdeps/ieee754/dbl-64/s_atan.c
+++ b/sysdeps/ieee754/dbl-64/s_atan.c
@@ -97,7 +97,10 @@ atan (double x)
 	      yy *= x * v;
 
 	      if ((y = x + (yy - U1 * x)) == x + (yy + U1 * x))
+	      {
+	        LIBC_PROBE (atan_probe, 2, 1, &x);
 		return y;
+		}
 
 	      EMULV (x, x, v, vv, t1, t2, t3, t4, t5);	/* v+vv=x^2 */
 
@@ -119,7 +122,10 @@ atan (double x)
 		    t8);
 	      ADD2 (x, 0, s2, ss2, s1, ss1, t1, t2);
 	      if ((y = s1 + (ss1 - U5 * s1)) == s1 + (ss1 + U5 * s1))
+	      {
+	        LIBC_PROBE (atan_probe, 2, 2, &x);
 		return y;
+		}
 
 	      return atanMp (x, pr);
 	    }
@@ -151,7 +157,10 @@ atan (double x)
 		u2 = U24;
 	    }			/* 3/4 <= u <= 1  */
 	  if ((y = t1 + (yy - u2 * t1)) == t1 + (yy + u2 * t1))
+	  {
+	        LIBC_PROBE (atan_probe, 2, 3, &x);
 	    return __signArctan (x, y);
+	    }
 
 	  z = u - hij[i][0].d;
 
@@ -171,7 +180,10 @@ atan (double x)
 	  MUL2 (z, 0, s2, ss2, s1, ss1, t1, t2, t3, t4, t5, t6, t7, t8);
 	  ADD2 (hij[i][1].d, hij[i][2].d, s1, ss1, s2, ss2, t1, t2);
 	  if ((y = s2 + (ss2 - U6 * s2)) == s2 + (ss2 + U6 * s2))
+	  {
+	        LIBC_PROBE (atan_probe, 2, 4, &x);
 	    return __signArctan (x, y);
+	    }
 
 	  return atanMp (x, pr);
 	}
@@ -199,7 +211,10 @@ atan (double x)
 	  else
 	    u3 = U32;           /* w >= 1/2 */
 	  if ((y = t1 + (yy - u3)) == t1 + (yy + u3))
+	  {
+	        LIBC_PROBE (atan_probe, 2, 5, &x);
 	    return __signArctan (x, y);
+	    }
 
 	  DIV2 (1, 0, u, 0, w, ww, t1, t2, t3, t4, t5, t6, t7, t8, t9,
 		t10);
@@ -223,7 +238,10 @@ atan (double x)
 	  ADD2 (hij[i][1].d, hij[i][2].d, s1, ss1, s2, ss2, t1, t2);
 	  SUB2 (HPI, HPI1, s2, ss2, s1, ss1, t1, t2);
 	  if ((y = s1 + (ss1 - U7)) == s1 + (ss1 + U7))
+	  {
+	        LIBC_PROBE (atan_probe, 2, 6, &x);
 	    return __signArctan (x, y);
+	    }
 
 	  return atanMp (x, pr);
 	}
@@ -246,7 +264,10 @@ atan (double x)
 	      ESUB (HPI, w, t3, cor);
 	      yy = ((HPI1 + cor) - ww) - yy;
 	      if ((y = t3 + (yy - U4)) == t3 + (yy + U4))
+	      {
+	        LIBC_PROBE (atan_probe, 2, 7, &x);
 		return __signArctan (x, y);
+		}
 
 	      DIV2 (1, 0, u, 0, w, ww, t1, t2, t3, t4, t5, t6, t7, t8,
 		    t9, t10);
@@ -271,7 +292,10 @@ atan (double x)
 	      SUB2 (HPI, HPI1, s1, ss1, s2, ss2, t1, t2);
 
 	      if ((y = s2 + (ss2 - U8)) == s2 + (ss2 + U8))
+	      {
+	        LIBC_PROBE (atan_probe, 2, 8, &x);
 		return __signArctan (x, y);
+		}
 
 	      return atanMp (x, pr);
 	    }
diff --git a/sysdeps/ieee754/dbl-64/s_sin.c b/sysdeps/ieee754/dbl-64/s_sin.c
index 6105e9f..7210daf 100644
--- a/sysdeps/ieee754/dbl-64/s_sin.c
+++ b/sysdeps/ieee754/dbl-64/s_sin.c
@@ -303,7 +303,7 @@ __sin (double x)
       t = POLYNOMIAL (xx) * (xx * x);
       res = x + t;
       cor = (x - res) + t;
-      retval = (res == res + 1.07 * cor) ? res : slow (x);
+      if (res == res + 1.07 * cor) { LIBC_PROBE (sin_probe, 2, 1, &x); retval = res; } else retval = slow (x);
     }				/*  else  if (k < 0x3fd00000)    */
 /*---------------------------- 0.25<|x|< 0.855469---------------------- */
   else if (k < 0x3feb6000)
@@ -322,7 +322,7 @@ __sin (double x)
       cor = (ssn + s * ccs - sn * c) + cs * s;
       res = sn + cor;
       cor = (sn - res) + cor;
-      retval = (res == res + 1.096 * cor) ? res : slow1 (x);
+      if (res == res + 1.096 * cor) { LIBC_PROBE (sin_probe, 2, 2, &x); retval = res; } else retval = slow1 (x);
     }				/*   else  if (k < 0x3feb6000)    */
 
 /*----------------------- 0.855469  <|x|<2.426265  ----------------------*/
@@ -341,7 +341,7 @@ __sin (double x)
 	  y = (-hp1) - (y + (u.x - big));
 	}
       res = do_cos (u, y, &cor);
-      retval = (res == res + 1.020 * cor) ? ((m > 0) ? res : -res) : slow2 (x);
+      if (res == res + 1.020 * cor) { LIBC_PROBE (sin_probe, 2, 3, &x); retval = ((m > 0) ? res : -res); } else retval = slow2 (x);
     }				/*   else  if (k < 0x400368fd)    */
 
 /*-------------------------- 2.426265<|x|< 105414350 ----------------------*/
@@ -372,7 +372,7 @@ __sin (double x)
 	      /* Taylor series.  */
 	      res = TAYLOR_SIN (xx, a, da, cor);
 	      cor = (cor > 0) ? 1.02 * cor + eps : 1.02 * cor - eps;
-	      retval = (res == res + cor) ? res : sloww (a, da, x);
+	      if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 4, &x); retval = res; } else retval = sloww (a, da, x);
 	    }
 	  else
 	    {
@@ -388,8 +388,7 @@ __sin (double x)
 	      y = a - (u.x - big);
 	      res = do_sin (u, y, da, &cor);
 	      cor = (cor > 0) ? 1.035 * cor + eps : 1.035 * cor - eps;
-	      retval = ((res == res + cor) ? ((m) ? res : -res)
-			: sloww1 (a, da, x, m));
+	      if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 5, &x); retval = ((m) ? res : -res); } else retval = sloww1 (a, da, x, m);
 	    }
 	  break;
 
@@ -404,8 +403,7 @@ __sin (double x)
 	  y = a - (u.x - big) + da;
 	  res = do_cos (u, y, &cor);
 	  cor = (cor > 0) ? 1.025 * cor + eps : 1.025 * cor - eps;
-	  retval = ((res == res + cor) ? ((n & 2) ? -res : res)
-		    : sloww2 (a, da, x, n));
+	  if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 6, &x); retval = ((n & 2) ? -res : res); } else retval = sloww2 (a, da, x, n);
 	  break;
 	}
     }				/*   else  if (k <  0x419921FB )    */
@@ -443,7 +441,7 @@ __sin (double x)
 	      /* Taylor series.  */
 	      res = TAYLOR_SIN (xx, a, da, cor);
 	      cor = (cor > 0) ? 1.02 * cor + eps : 1.02 * cor - eps;
-	      retval = (res == res + cor) ? res : bsloww (a, da, x, n);
+	      if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 7, &x); retval = res; } else retval = bsloww (a, da, x, n);
 	    }
 	  else
 	    {
@@ -462,8 +460,7 @@ __sin (double x)
 	      y = a - (u.x - big);
 	      res = do_sin (u, y, db, &cor);
 	      cor = (cor > 0) ? 1.035 * cor + eps : 1.035 * cor - eps;
-	      retval = ((res == res + cor) ? ((m) ? res : -res)
-			: bsloww1 (a, da, x, n));
+	      if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 8, &x); retval = ((m) ? res : -res); } else retval = bsloww1 (a, da, x, n);
 	    }
 	  break;
 
@@ -478,8 +475,7 @@ __sin (double x)
 	  y = a - (u.x - big) + da;
 	  res = do_cos (u, y, &cor);
 	  cor = (cor > 0) ? 1.025 * cor + eps : 1.025 * cor - eps;
-	  retval = ((res == res + cor) ? ((n & 2) ? -res : res)
-		    : bsloww2 (a, da, x, n));
+	  if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 9, &x); retval = ((n & 2) ? -res : res); } else retval = bsloww2 (a, da, x, n);
 	  break;
 	}
     }				/*   else  if (k <  0x42F00000 )   */
@@ -532,7 +528,7 @@ __cos (double x)
       u.x = big + y;
       y = y - (u.x - big);
       res = do_cos (u, y, &cor);
-      retval = (res == res + 1.020 * cor) ? res : cslow2 (x);
+      if (res == res + 1.020 * cor) { LIBC_PROBE (cos_probe, 2, 1, &x); retval = res; } else retval = cslow2 (x);
     }				/*   else  if (k < 0x3feb6000)    */
 
   else if (k < 0x400368fd)
@@ -545,7 +541,7 @@ __cos (double x)
 	{
 	  res = TAYLOR_SIN (xx, a, da, cor);
 	  cor = (cor > 0) ? 1.02 * cor + 1.0e-31 : 1.02 * cor - 1.0e-31;
-	  retval = (res == res + cor) ? res : csloww (a, da, x);
+	  if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 2, &x); retval = res; } else retval = csloww (a, da, x);
 	}
       else
 	{
@@ -563,8 +559,7 @@ __cos (double x)
 	  y = a - (u.x - big);
 	  res = do_sin (u, y, da, &cor);
 	  cor = (cor > 0) ? 1.035 * cor + 1.0e-31 : 1.035 * cor - 1.0e-31;
-	  retval = ((res == res + cor) ? ((m) ? res : -res)
-		    : csloww1 (a, da, x, m));
+	  if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 3, &x); retval = ((m) ? res : -res); } else retval = csloww1 (a, da, x, m);
 	}
 
     }				/*   else  if (k < 0x400368fd)    */
@@ -596,7 +591,7 @@ __cos (double x)
 	    {
 	      res = TAYLOR_SIN (xx, a, da, cor);
 	      cor = (cor > 0) ? 1.02 * cor + eps : 1.02 * cor - eps;
-	      retval = (res == res + cor) ? res : csloww (a, da, x);
+	      if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 4, &x); retval = res; } else retval = csloww (a, da, x);
 	    }
 	  else
 	    {
@@ -614,8 +609,7 @@ __cos (double x)
 	      y = a - (u.x - big);
 	      res = do_sin (u, y, da, &cor);
 	      cor = (cor > 0) ? 1.035 * cor + eps : 1.035 * cor - eps;
-	      retval = ((res == res + cor) ? ((m) ? res : -res)
-			: csloww1 (a, da, x, m));
+	      if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 5, &x); retval = ((m) ? res : -res); } else retval = csloww1 (a, da, x, m);
 	    }
 	  break;
 
@@ -630,8 +624,7 @@ __cos (double x)
 	  y = a - (u.x - big) + da;
 	  res = do_cos (u, y, &cor);
 	  cor = (cor > 0) ? 1.025 * cor + eps : 1.025 * cor - eps;
-	  retval = ((res == res + cor) ? ((n) ? -res : res)
-		    : csloww2 (a, da, x, n));
+	  if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 6, &x); retval = ((n) ? -res : res); } else retval = csloww2 (a, da, x, n);
 	  break;
 	}
     }				/*   else  if (k <  0x419921FB )    */
@@ -667,7 +660,7 @@ __cos (double x)
 	    {
 	      res = TAYLOR_SIN (xx, a, da, cor);
 	      cor = (cor > 0) ? 1.02 * cor + eps : 1.02 * cor - eps;
-	      retval = (res == res + cor) ? res : bsloww (a, da, x, n);
+	      if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 7, &x); retval = res; } else retval = bsloww (a, da, x, n);
 	    }
 	  else
 	    {
@@ -686,8 +679,7 @@ __cos (double x)
 	      y = a - (u.x - big);
 	      res = do_sin (u, y, db, &cor);
 	      cor = (cor > 0) ? 1.035 * cor + eps : 1.035 * cor - eps;
-	      retval = ((res == res + cor) ? ((m) ? res : -res)
-			: bsloww1 (a, da, x, n));
+	      if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 8, &x); retval = ((m) ? res : -res); } else retval = bsloww1 (a, da, x, n);
 	    }
 	  break;
 
@@ -702,8 +694,7 @@ __cos (double x)
 	  y = a - (u.x - big) + da;
 	  res = do_cos (u, y, &cor);
 	  cor = (cor > 0) ? 1.025 * cor + eps : 1.025 * cor - eps;
-	  retval = ((res == res + cor) ? ((n) ? -res : res)
-		    : bsloww2 (a, da, x, n));
+	  if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 9, &x); retval = ((n) ? -res : res); } else retval = bsloww2 (a, da, x, n);
 	  break;
 	}
     }				/*   else  if (k <  0x42F00000 )    */
@@ -734,12 +725,18 @@ slow (double x)
   double res, cor, w[2];
   res = TAYLOR_SLOW (x, 0, cor);
   if (res == res + 1.0007 * cor)
-    return res;
+    {
+    LIBC_PROBE (sin_probe, 2, 10, &x);
+      return res;
+    }
   else
     {
       __dubsin (ABS (x), 0, w);
       if (w[0] == w[0] + 1.000000001 * w[1])
+        {
+	LIBC_PROBE (sin_probe, 2, 11, &x);
 	return (x > 0) ? w[0] : -w[0];
+	}
       else
 	return (x > 0) ? __mpsin (x, 0, false) : -__mpsin (-x, 0, false);
     }
@@ -761,12 +758,18 @@ slow1 (double x)
   y = y - (u.x - big);
   res = do_sin_slow (u, y, 0, 0, &cor);
   if (res == res + cor)
+  {
+  LIBC_PROBE (sin_probe, 2, 12, &x);
     return (x > 0) ? res : -res;
+    }
   else
     {
       __dubsin (ABS (x), 0, w);
       if (w[0] == w[0] + 1.000000005 * w[1])
+      {
+      LIBC_PROBE (sin_probe, 2, 13, &x);
 	return (x > 0) ? w[0] : -w[0];
+	}
       else
 	return (x > 0) ? __mpsin (x, 0, false) : -__mpsin (-x, 0, false);
     }
@@ -799,7 +802,8 @@ slow2 (double x)
     }
   res = do_cos_slow (u, y, del, 0, &cor);
   if (res == res + cor)
-    return (x > 0) ? res : -res;
+  { LIBC_PROBE (sin_probe, 2, 14, &x);
+    return (x > 0) ? res : -res; }
   else
     {
       y = ABS (x) - hp0;
@@ -807,7 +811,8 @@ slow2 (double x)
       y2 = (y - y1) - hp1;
       __docos (y1, y2, w);
       if (w[0] == w[0] + 1.000000005 * w[1])
-	return (x > 0) ? w[0] : -w[0];
+  { LIBC_PROBE (sin_probe, 2, 15, &x);
+	return (x > 0) ? w[0] : -w[0]; }
       else
 	return (x > 0) ? __mpsin (x, 0, false) : -__mpsin (-x, 0, false);
     }
@@ -835,7 +840,8 @@ sloww (double x, double dx, double orig)
     cor = 1.0005 * cor - ABS (orig) * 3.1e-30;
 
   if (res == res + cor)
-    return res;
+  { LIBC_PROBE (sin_probe, 2, 16, &orig);
+    return res;}
   else
     {
       (x > 0) ? __dubsin (x, dx, w) : __dubsin (-x, -dx, w);
@@ -845,7 +851,8 @@ sloww (double x, double dx, double orig)
 	cor = 1.000000001 * w[1] - ABS (orig) * 1.1e-30;
 
       if (w[0] == w[0] + cor)
-	return (x > 0) ? w[0] : -w[0];
+  { LIBC_PROBE (sin_probe, 2, 17, &orig);
+	return (x > 0) ? w[0] : -w[0]; }
       else
 	{
 	  t = (orig * hpinv + toint);
@@ -871,7 +878,8 @@ sloww (double x, double dx, double orig)
 	    cor = 1.000000001 * w[1] - ABS (orig) * 1.1e-40;
 
 	  if (w[0] == w[0] + cor)
-	    return (a > 0) ? w[0] : -w[0];
+  { LIBC_PROBE (sin_probe, 2, 18, &orig);
+	    return (a > 0) ? w[0] : -w[0]; }
 	  else
 	    return __mpsin (orig, 0, true);
 	}
@@ -897,7 +905,8 @@ sloww1 (double x, double dx, double orig, int m)
   res = do_sin_slow (u, y, dx, 3.1e-30 * ABS (orig), &cor);
 
   if (res == res + cor)
-    return (m > 0) ? res : -res;
+  { LIBC_PROBE (sin_probe, 2, 19, &orig);
+    return (m > 0) ? res : -res; }
   else
     {
       __dubsin (x, dx, w);
@@ -908,7 +917,8 @@ sloww1 (double x, double dx, double orig, int m)
 	cor = 1.000000005 * w[1] - 1.1e-30 * ABS (orig);
 
       if (w[0] == w[0] + cor)
-	return (m > 0) ? w[0] : -w[0];
+  { LIBC_PROBE (sin_probe, 2, 20, &orig);
+	return (m > 0) ? w[0] : -w[0]; }
       else
 	return __mpsin (orig, 0, true);
     }
@@ -933,7 +943,8 @@ sloww2 (double x, double dx, double orig, int n)
   res = do_cos_slow (u, y, dx, 3.1e-30 * ABS (orig), &cor);
 
   if (res == res + cor)
-    return (n & 2) ? -res : res;
+  { LIBC_PROBE (sin_probe, 2, 21, &orig);
+    return (n & 2) ? -res : res; }
   else
     {
       __docos (x, dx, w);
@@ -944,7 +955,8 @@ sloww2 (double x, double dx, double orig, int n)
 	cor = 1.000000005 * w[1] - 1.1e-30 * ABS (orig);
 
       if (w[0] == w[0] + cor)
-	return (n & 2) ? -w[0] : w[0];
+  { LIBC_PROBE (sin_probe, 2, 22, &orig);
+	return (n & 2) ? -w[0] : w[0]; }
       else
 	return __mpsin (orig, 0, true);
     }
@@ -967,7 +979,8 @@ bsloww (double x, double dx, double orig, int n)
   res = TAYLOR_SLOW (x, dx, cor);
   cor = (cor > 0) ? 1.0005 * cor + 1.1e-24 : 1.0005 * cor - 1.1e-24;
   if (res == res + cor)
-    return res;
+  { LIBC_PROBE (sincos_probe, 2, 1, &orig);
+    return res; }
   else
     {
       (x > 0) ? __dubsin (x, dx, w) : __dubsin (-x, -dx, w);
@@ -976,7 +989,8 @@ bsloww (double x, double dx, double orig, int n)
       else
 	cor = 1.000000001 * w[1] - 1.1e-24;
       if (w[0] == w[0] + cor)
-	return (x > 0) ? w[0] : -w[0];
+  { LIBC_PROBE (sincos_probe, 2, 2, &orig);
+	return (x > 0) ? w[0] : -w[0]; }
       else
 	return (n & 1) ? __mpcos (orig, 0, true) : __mpsin (orig, 0, true);
     }
@@ -1002,7 +1016,8 @@ bsloww1 (double x, double dx, double orig, int n)
   dx = (x > 0) ? dx : -dx;
   res = do_sin_slow (u, y, dx, 1.1e-24, &cor);
   if (res == res + cor)
-    return (x > 0) ? res : -res;
+  { LIBC_PROBE (sincos_probe, 2, 3, &orig);
+    return (x > 0) ? res : -res; }
   else
     {
       __dubsin (ABS (x), dx, w);
@@ -1013,7 +1028,8 @@ bsloww1 (double x, double dx, double orig, int n)
 	cor = 1.000000005 * w[1] - 1.1e-24;
 
       if (w[0] == w[0] + cor)
-	return (x > 0) ? w[0] : -w[0];
+  { LIBC_PROBE (sincos_probe, 2, 4, &orig);
+	return (x > 0) ? w[0] : -w[0]; }
       else
 	return (n & 1) ? __mpcos (orig, 0, true) : __mpsin (orig, 0, true);
     }
@@ -1039,7 +1055,8 @@ bsloww2 (double x, double dx, double orig, int n)
   dx = (x > 0) ? dx : -dx;
   res = do_cos_slow (u, y, dx, 1.1e-24, &cor);
   if (res == res + cor)
-    return (n & 2) ? -res : res;
+  { LIBC_PROBE (sincos_probe, 2, 5, &orig);
+    return (n & 2) ? -res : res; }
   else
     {
       __docos (ABS (x), dx, w);
@@ -1050,7 +1067,8 @@ bsloww2 (double x, double dx, double orig, int n)
 	cor = 1.000000005 * w[1] - 1.1e-24;
 
       if (w[0] == w[0] + cor)
-	return (n & 2) ? -w[0] : w[0];
+  { LIBC_PROBE (sincos_probe, 2, 6, &orig);
+	return (n & 2) ? -w[0] : w[0]; }
       else
 	return (n & 1) ? __mpsin (orig, 0, true) : __mpcos (orig, 0, true);
     }
@@ -1073,13 +1091,15 @@ cslow2 (double x)
   y = y - (u.x - big);
   res = do_cos_slow (u, y, 0, 0, &cor);
   if (res == res + cor)
-    return res;
+  { LIBC_PROBE (cos_probe, 2, 10, &x);
+    return res; }
   else
     {
       y = ABS (x);
       __docos (y, 0, w);
       if (w[0] == w[0] + 1.000000005 * w[1])
-	return w[0];
+  { LIBC_PROBE (cos_probe, 2, 11, &x);
+	return w[0]; }
       else
 	return __mpcos (x, 0, false);
     }
@@ -1110,7 +1130,8 @@ csloww (double x, double dx, double orig)
     cor = 1.0005 * cor - ABS (orig) * 3.1e-30;
 
   if (res == res + cor)
-    return res;
+  { LIBC_PROBE (cos_probe, 2, 12, &orig);
+    return res; }
   else
     {
       (x > 0) ? __dubsin (x, dx, w) : __dubsin (-x, -dx, w);
@@ -1121,7 +1142,8 @@ csloww (double x, double dx, double orig)
 	cor = 1.000000001 * w[1] - ABS (orig) * 1.1e-30;
 
       if (w[0] == w[0] + cor)
-	return (x > 0) ? w[0] : -w[0];
+  { LIBC_PROBE (cos_probe, 2, 13, &orig);
+	return (x > 0) ? w[0] : -w[0]; }
       else
 	{
 	  t = (orig * hpinv + toint);
@@ -1148,7 +1170,8 @@ csloww (double x, double dx, double orig)
 	    cor = 1.000000001 * w[1] - ABS (orig) * 1.1e-40;
 
 	  if (w[0] == w[0] + cor)
-	    return (a > 0) ? w[0] : -w[0];
+  { LIBC_PROBE (cos_probe, 2, 14, &orig);
+	    return (a > 0) ? w[0] : -w[0]; }
 	  else
 	    return __mpcos (orig, 0, true);
 	}
@@ -1174,7 +1197,8 @@ csloww1 (double x, double dx, double orig, int m)
   res = do_sin_slow (u, y, dx, 3.1e-30 * ABS (orig), &cor);
 
   if (res == res + cor)
-    return (m > 0) ? res : -res;
+  { LIBC_PROBE (cos_probe, 2, 15, &orig);
+    return (m > 0) ? res : -res; }
   else
     {
       __dubsin (x, dx, w);
@@ -1183,7 +1207,8 @@ csloww1 (double x, double dx, double orig, int m)
       else
 	cor = 1.000000005 * w[1] - 1.1e-30 * ABS (orig);
       if (w[0] == w[0] + cor)
-	return (m > 0) ? w[0] : -w[0];
+  { LIBC_PROBE (cos_probe, 2, 16, &orig);
+	return (m > 0) ? w[0] : -w[0]; }
       else
 	return __mpcos (orig, 0, true);
     }
@@ -1209,7 +1234,8 @@ csloww2 (double x, double dx, double orig, int n)
   res = do_cos_slow (u, y, dx, 3.1e-30 * ABS (orig), &cor);
 
   if (res == res + cor)
-    return (n) ? -res : res;
+  { LIBC_PROBE (cos_probe, 2, 17, &orig);
+    return (n) ? -res : res; }
   else
     {
       __docos (x, dx, w);
@@ -1218,7 +1244,8 @@ csloww2 (double x, double dx, double orig, int n)
       else
 	cor = 1.000000005 * w[1] - 1.1e-30 * ABS (orig);
       if (w[0] == w[0] + cor)
-	return (n) ? -w[0] : w[0];
+  { LIBC_PROBE (cos_probe, 2, 18, &orig);
+	return (n) ? -w[0] : w[0]; }
       else
 	return __mpcos (orig, 0, true);
     }
diff --git a/sysdeps/ieee754/dbl-64/s_tanh.c b/sysdeps/ieee754/dbl-64/s_tanh.c
index 23cfcde..4286a71 100644
--- a/sysdeps/ieee754/dbl-64/s_tanh.c
+++ b/sysdeps/ieee754/dbl-64/s_tanh.c
@@ -40,6 +40,7 @@ static char rcsid[] = "$NetBSD: s_tanh.c,v 1.7 1995/05/10 20:48:22 jtc Exp $";
 
 #include <math.h>
 #include <math_private.h>
+#include <stap-probe.h>
 
 static const double one = 1.0, two = 2.0, tiny = 1.0e-300;
 
@@ -73,11 +74,13 @@ __tanh (double x)
 	{
 	  t = __expm1 (two * fabs (x));
 	  z = one - two / (t + two);
+	  LIBC_PROBE (tanh_probe, 2, 1, &x);
 	}
       else
 	{
 	  t = __expm1 (-two * fabs (x));
 	  z = -t / (t + two);
+	  LIBC_PROBE (tanh_probe, 2, 2, &x);
 	}
       /* |x| > 22, return +-1 */
     }
diff --git a/sysdeps/ieee754/dbl-64/wordsize-64/e_acosh.c b/sysdeps/ieee754/dbl-64/wordsize-64/e_acosh.c
index 26268f2..8cb4702 100644
--- a/sysdeps/ieee754/dbl-64/wordsize-64/e_acosh.c
+++ b/sysdeps/ieee754/dbl-64/wordsize-64/e_acosh.c
@@ -26,6 +26,7 @@
 
 #include <math.h>
 #include <math_private.h>
+#include <stap-probe.h>
 
 static const double
 one	= 1.0,
@@ -46,17 +47,22 @@ __ieee754_acosh (double x)
 	    /* x is inf of NaN */
 	    return x + x;
 	  else
+	  {
+	    LIBC_PROBE (acosh_probe, 2, 1, &x);
 	    return __ieee754_log (x) + ln2;/* acosh(huge)=log(2x) */
+	    }
 	}
 
       /* 2**28 > x > 2 */
       double t = x * x;
+	    LIBC_PROBE (acosh_probe, 2, 2, &x);
       return __ieee754_log (2.0 * x - one / (x + __ieee754_sqrt (t - one)));
     }
   else if (__builtin_expect (hx > INT64_C (0x3ff0000000000000), 1))
     {
       /* 1<x<2 */
       double t = x - one;
+	    LIBC_PROBE (acosh_probe, 2, 3, &x);
       return __log1p (t + __ieee754_sqrt (2.0 * t + t * t));
     }
   else if (__builtin_expect (hx == INT64_C (0x3ff0000000000000), 1))
diff --git a/sysdeps/ieee754/dbl-64/wordsize-64/e_cosh.c b/sysdeps/ieee754/dbl-64/wordsize-64/e_cosh.c
index 8459352..ecf8210 100644
--- a/sysdeps/ieee754/dbl-64/wordsize-64/e_cosh.c
+++ b/sysdeps/ieee754/dbl-64/wordsize-64/e_cosh.c
@@ -33,6 +33,7 @@
 
 #include <math.h>
 #include <math_private.h>
+#include <stap-probe.h>
 
 static const double one = 1.0, half=0.5, huge = 1.0e300;
 
@@ -52,17 +53,23 @@ __ieee754_cosh (double x)
 		if(ix<0x3fd62e43) {
 		    t = __expm1(fabs(x));
 		    w = one+t;
+		    LIBC_PROBE (cosh_probe, 2, 1, &x);
 		    if (ix<0x3c800000) return w;	/* cosh(tiny) = 1 */
 		    return one+(t*t)/(w+w);
 		}
 
+		    LIBC_PROBE (cosh_probe, 2, 2, &x);
 	    /* |x| in [0.5*ln2,22], return (exp(|x|)+1/exp(|x|)/2; */
 		t = __ieee754_exp(fabs(x));
 		return half*t+half/t;
 	}
 
     /* |x| in [22, log(maxdouble)] return half*exp(|x|) */
-	if (ix < 0x40862e42)  return half*__ieee754_exp(fabs(x));
+	if (ix < 0x40862e42)  
+	{
+		    LIBC_PROBE (cosh_probe, 2, 3, &x);
+	return half*__ieee754_exp(fabs(x));
+	}
 
     /* |x| in [log(maxdouble), overflowthresold] */
 	int64_t fix;
@@ -71,6 +78,7 @@ __ieee754_cosh (double x)
 	if (fix <= UINT64_C(0x408633ce8fb9f87d)) {
 	    w = __ieee754_exp(half*fabs(x));
 	    t = half*w;
+		    LIBC_PROBE (cosh_probe, 2, 4, &x);
 	    return t*w;
 	}
 

-----------------------------------------------------------------------


hooks/post-receive
-- 
GNU C Library master sources


Index Nav: [Date Index] [Subject Index] [Author Index] [Thread Index]
Message Nav: [Date Prev] [Date Next] [Thread Prev] [Thread Next]